Loading distributor info...
| Description | Phleomycin D1 is a glycopeptide antibiotic that targets DNA. It exerts its biological activity by binding to and cleaving DNA, leading to cell death. Additionally, Phleomycin D1 induces cell cycle arrest at the S phase, making it a valuable reagent for research applications in cancer biology and molecular genetics. |
|---|
| Catalog Num | A46570 |
|---|---|
| Formula | C55H86N20O21S2 |
| Molecular Weight | 1427.52 |
| CAS Number | 11031-11-1 |
| SMILES | O=C(C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C)N[C@H](C(N[C@H](C)[C@@H](O)[C@H](C)C(N[C@]([C@H](O)C)([H])C(NCCC2=N[C@@H](C3=NC(C(NCCCCNC(N)=N)=O)=CS3)CS2)=O)=O)=O)[C@H](C4=CN=CN4)O[C@H]5[C@H]([C@H]([C@@H]([C@@H](O5)CO)O)O)O[C@]6([H])[C@H]([C@H]([C@@H]([C@H](O6)CO)O)OC(N)=O)O |
| Synonyms | PLM D1 |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
