Vps34-PIK-III (PIK-III) is a selective inhibitor of VPS34 enzymatic activity.
Loading distributor info...
| Description | Vps34-PIK-III (PIK-III) is a selective inhibitor of VPS34 enzymatic activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15868 |
|---|---|
| Formula | C17H17N7 |
| Molecular Weight | 319.36 |
| CAS Number | 1383716-40-2 |
| SMILES | NC1=NC=C(C2=NC(NC3=CC=NC=C3)=NC=C2)C(CC4CC4)=N1 |
| Synonyms | VPS34-IN2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (175.34 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL (175.34 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.31 mL | 156.56 mL | 313.13 mL |
| 0.5 mM | 6.26 mL | 31.31 mL | 62.63 mL |
| 1 mM | 3.13 mL | 15.66 mL | 31.31 mL |
| 5 mM | 0.63 mL | 3.13 mL | 6.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
