Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Piroxicam is an effective and potent inhibitor of prostaglandin synthesis and a Cox-1 and Cox-2 inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10736 |
|---|---|
| Formula | C15H13N3O4S |
| Molecular Weight | 331.34 |
| CAS Number | 36322-90-4 |
| SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)NC3=CC=CC=N3 |
| Synonyms | Roxam |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (193.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (3.01 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.18 mL | 150.9 mL | 301.8 mL |
| 0.5 mM | 6.04 mL | 30.18 mL | 60.36 mL |
| 1 mM | 3.02 mL | 15.09 mL | 30.18 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
