Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Robenidine hydrochloride is an antibiotic used for the control of coccidiosis, a debilitating protozoal infection in poultry. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16991 |
|---|---|
| Formula | C15H14Cl3N5 |
| Molecular Weight | 370.66 |
| CAS Number | 25875-50-7 |
| SMILES | N=C(N/N=C/C1=CC=C(Cl)C=C1)N/N=C/C2=CC=C(Cl)C=C2.[H]Cl |
| Synonyms | Robenidine HCl, Cycostat, Chimcoccide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (194.24 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.98 mL | 134.89 mL | 269.79 mL |
| 0.5 mM | 5.4 mL | 26.98 mL | 53.96 mL |
| 1 mM | 2.7 mL | 13.49 mL | 26.98 mL |
| 5 mM | 0.54 mL | 2.7 mL | 5.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
