Loading distributor info...
| Description | Rotundic acid, a triterpenoid obtained from I. rotunda, induces DNA damage and cell apoptosis in hepatocellular carcinoma through AKT/mTOR and MAPK Pathways. Rotundic acid possesses anti-inflammatory and cardio-protective abilities. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A22390 |
|---|---|
| Formula | C30H48O5 |
| Molecular Weight | 488.7 |
| CAS Number | 20137-37-5 |
| SMILES | C[C@@]1(CO)[C@@H](O)CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@](C)(O)[C@H](C)CC[C@@](C(O)=O)5CC[C@](C)4[C@@](C)3CC[C@@]12[H] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
