Signaling Pathway
Raf/VEGFR3 inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sorafenib D3 (Bay 43-9006 D3) is the deuterium labeled Sorafenib. Sorafenib is a multikinase inhibitor IC50s of 6 nM, 20 nM, and 22 nM for Raf-1, B-Raf, and VEGFR-3, respectively. |
|---|
| Catalog Num | A21489 |
|---|---|
| Formula | C21H13D3ClF3N4O3 |
| Molecular Weight | 467.84 |
| CAS Number | 1130115-44-4 |
| SMILES | O=C(C1=NC=CC(OC2=CC=C(NC(NC3=CC=C(Cl)C(C(F)(F)F)=C3)=O)C=C2)=C1)NC([2H])([2H])[2H] |
| Synonyms | Bay 43-9006 (D3) |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (196.65 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.37 mL | 106.87 mL | 213.75 mL |
| 0.5 mM | 4.27 mL | 21.37 mL | 42.75 mL |
| 1 mM | 2.14 mL | 10.69 mL | 21.37 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
