Signaling Pathway
Raf/VEGFR3 inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sorafenib (Bay 43-9006) is a potent, orally active multikinase inhibitor with IC50s of 6 nM, 20 nM, and 22 nM for Raf-1, B-Raf, and VEGFR-3, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17857 |
|---|---|
| Formula | C21H16ClF3N4O3 |
| Molecular Weight | 464.83 |
| CAS Number | 284461-73-0 |
| SMILES | O=C(NC(C=C1)=CC=C1OC2=CC(C(NC)=O)=NC=C2)NC3=CC=C(Cl)C(C(F)(F)F)=C3 |
| Synonyms | Bay 43-9006, Bay-43-9006, Bay43-9006 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 59 mg/mL (126.92 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%DMSO+45%PEG400+50%H2O | 0.35 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.51 mL | 107.57 mL | 215.13 mL |
| 0.5 mM | 4.3 mL | 21.51 mL | 43.03 mL |
| 1 mM | 2.15 mL | 10.76 mL | 21.51 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
