Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Trichostatin A (TSA) inhibits the HDACs 1, 3, 4, 6 and 10 with IC50 values around 20 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10947 |
|---|---|
| Formula | C17H22N2O3 |
| Molecular Weight | 302.4 |
| CAS Number | 58880-19-6 |
| SMILES | C[C@H](/C=C(\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C |
| Synonyms | Trichostatin A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 20 mg/mL (66.13 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.07 mL | 165.34 mL | 330.69 mL |
| 0.5 mM | 6.61 mL | 33.07 mL | 66.14 mL |
| 1 mM | 3.31 mL | 16.53 mL | 33.07 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
