Loading distributor info...
| Description | 4-Methylbenzylidene camphor(4-MBC; Enzacamene)is an organic camphor derivative that is used in the cosmetic industry for its ability to protect the skin against UV, specifically UV B radiation. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17293 |
|---|---|
| Formula | C18H22O |
| Molecular Weight | 254.37 |
| CAS Number | 36861-47-9 |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(/C2=C\C3=CC=C(C)C=C3)=O |
| Synonyms | 4-MBC; Enzacamene |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (188.7 mM) | |
| Water | Insoluble | ||
| Ethanol | 48 mg/mL (188.7 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.31 mL | 196.56 mL | 393.13 mL |
| 0.5 mM | 7.86 mL | 39.31 mL | 78.63 mL |
| 1 mM | 3.93 mL | 19.66 mL | 39.31 mL |
| 5 mM | 0.79 mL | 3.93 mL | 7.86 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
