Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aspirin is a non-selective and irreversible inhibitor of COX-1 and COX-2 with IC50s of 5 and 210 μg/mL. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11797 |
|---|---|
| Formula | C9H8O4 |
| Molecular Weight | 180.16 |
| CAS Number | 50-78-2 |
| SMILES | OC(C1=C(OC(C)=O)C=CC=C1)=O |
| Synonyms | Acetylsalicylic Acid; ASA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 34 mg/mL (188.72 mM) | |
| Water | Insoluble | ||
| Ethanol | 34 mg/mL (188.72 mM) | ||
| In vivo | 4% DMSO+PBS | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 55.51 mL | 277.53 mL | 555.06 mL |
| 0.5 mM | 11.1 mL | 55.51 mL | 111.01 mL |
| 1 mM | 5.55 mL | 27.75 mL | 55.51 mL |
| 5 mM | 1.11 mL | 5.55 mL | 11.1 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
