Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Decursin is an anticancer agent, with potential anti-inflammatory activity. |
|---|
| Catalog Num | A15699 |
|---|---|
| Formula | C19H20O5 |
| Molecular Weight | 328.36 |
| CAS Number | 5928-25-6 |
| SMILES | C/C(C)=C\C(O[C@H](C(C)(C)O1)CC2=C1C=C(O3)C(C=CC3=O)=C2)=O |
| Synonyms | (+)-Decursin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (185.76 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.45 mL | 152.27 mL | 304.54 mL |
| 0.5 mM | 6.09 mL | 30.45 mL | 60.91 mL |
| 1 mM | 3.05 mL | 15.23 mL | 30.45 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
