Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | (-)-Epigallocatechin gallate is a potent anti-oxidant polyphenol flavonoid isolated from green tea. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A10005 |
|---|---|
| Formula | C22H18O11 |
| Molecular Weight | 458.4 |
| CAS Number | 989-51-5 |
| SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| Synonyms | EGCG |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 64 mg/mL (139.62 mM) | |
| Water | Warmed: 20 mg/mL (43.63 mM) | ||
| Ethanol | Warmed: 74 mg/mL (161.44 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.82 mL | 109.08 mL | 218.15 mL |
| 0.5 mM | 4.36 mL | 21.82 mL | 43.63 mL |
| 1 mM | 2.18 mL | 10.91 mL | 21.82 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
