Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fexofenadine HCl is an antihistamine that inhibits Cox-1, Cox-2, and is a histamine H1 receptor agonist | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11859 |
|---|---|
| Formula | C32H39NO4.HCl |
| Molecular Weight | 538.13 |
| CAS Number | 153439-40-8 |
| SMILES | CC(C)(C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C(=O)O.Cl |
| Synonyms | Allegra |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (170.97 mM) | |
| Water | 2 mg/mL (3.71 mM) | ||
| Ethanol | 92 mg/mL (170.97 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.58 mL | 92.91 mL | 185.83 mL |
| 0.5 mM | 3.72 mL | 18.58 mL | 37.17 mL |
| 1 mM | 1.86 mL | 9.29 mL | 18.58 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
