Loading distributor info...
| Description | Gefitinib-based PROTAC 3, conjugating an EGFR binding element to a VHL ligand via a linker, induces EGFR degradation with DC50s of 11.7 nM and 22.3 nM in HCC827(exon 19 del) and H3255 (L858R mutantion) cells, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19093 |
|---|---|
| Formula | C47H57ClFN7O8S |
| Molecular Weight | 934.51 |
| CAS Number | 2230821-27-7 |
| SMILES | O=C([C@H]1N(C([C@@H](NC(CCOCCOCCCCCOC2=CC3=C(NC4=CC=C(F)C(Cl)=C4)N=CN=C3C=C2OC)=O)C(C)(C)C)=O)C[C@H](O)C1)NCC5=CC=C(C6=C(C)N=CS6)C=C5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (98.44 mM) | |
| Water | Insoluble | ||
| Ethanol | 92 mg/mL (98.44 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.7 mL | 53.5 mL | 107.01 mL |
| 0.5 mM | 2.14 mL | 10.7 mL | 21.4 mL |
| 1 mM | 1.07 mL | 5.35 mL | 10.7 mL |
| 5 mM | 0.21 mL | 1.07 mL | 2.14 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
