Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Gefitinib is an EGFR inhibitor, which interrupts signaling through the epidermal growth factor receptor (EGFR) in target cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10422 |
|---|---|
| Formula | C22H24ClFN4O3 |
| Molecular Weight | 446.9 |
| CAS Number | 184475-35-2 |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)OCCCN4CCOCC4 |
| Synonyms | ZD-1839 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 80 mg/mL (179 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (8.95 mM) | ||
| In vivo | 1% CMC Na | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.38 mL | 111.88 mL | 223.76 mL |
| 0.5 mM | 4.48 mL | 22.38 mL | 44.75 mL |
| 1 mM | 2.24 mL | 11.19 mL | 22.38 mL |
| 5 mM | 0.45 mL | 2.24 mL | 4.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
