Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FAAH-IN-2 (O-Desmorpholinopropyl Gefitinib) is a potent FAAH(fatty acid amide hydrolase) inhibitor extracted from Patent WO/2008/100977A2. |
|---|
| Catalog Num | A20528 |
|---|---|
| Formula | C15H11ClFN3O2 |
| Molecular Weight | 319.72 |
| CAS Number | 184475-71-6 |
| SMILES | OC1=CC2=C(NC3=CC=C(F)C(Cl)=C3)N=CN=C2C=C1OC |
| Synonyms | O-Desmorpholinopropyl Gefitinib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (109.46 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.28 mL | 156.39 mL | 312.77 mL |
| 0.5 mM | 6.26 mL | 31.28 mL | 62.55 mL |
| 1 mM | 3.13 mL | 15.64 mL | 31.28 mL |
| 5 mM | 0.63 mL | 3.13 mL | 6.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
