Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ibuprofen Lysine(Motrin) is a non-steroidal anti-inflammatory drug. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10462 |
|---|---|
| Formula | C19H32N2O4 |
| Molecular Weight | 352.5 |
| CAS Number | 57469-77-9 |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)O.C(CCN)C[C@@H](C(=O)O)N |
| Synonyms | NeoProfen |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 68 mg/mL (192.92 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.37 mL | 141.84 mL | 283.69 mL |
| 0.5 mM | 5.67 mL | 28.37 mL | 56.74 mL |
| 1 mM | 2.84 mL | 14.18 mL | 28.37 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
