Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Kynurenic acid, an endogenous tryptophan metabolite, is a broad-spectrum antagonist targeting NMDA, glutamate, α7 nicotinic acetylcholine receptor. Kynurenic acid is also an agonist of GPR35/CXCR8. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16581 |
|---|---|
| Formula | C10H7NO3 |
| Molecular Weight | 189.17 |
| CAS Number | 492-27-3 |
| SMILES | O=C(C1=NC2=CC=CC=C2C(O)=C1)O |
| Synonyms | Quinurenic acid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (47.57 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 52.86 mL | 264.31 mL | 528.63 mL |
| 0.5 mM | 10.57 mL | 52.86 mL | 105.73 mL |
| 1 mM | 5.29 mL | 26.43 mL | 52.86 mL |
| 5 mM | 1.06 mL | 5.29 mL | 10.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
