Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phosphoramidon Disodium Salt is a metalloendopeptidase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14243 |
|---|---|
| Formula | C23H34N3Na2O10P |
| Molecular Weight | 588.48 |
| CAS Number | 164204-38-0 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OP(=O)(N[C@@H](CC(C)C)C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)O)O)O)O)O.[Na][Na] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (152.93 mM) | |
| Water | 90 mg/mL (152.93 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.99 mL | 84.96 mL | 169.93 mL |
| 0.5 mM | 3.4 mL | 16.99 mL | 33.99 mL |
| 1 mM | 1.7 mL | 8.5 mL | 16.99 mL |
| 5 mM | 0.34 mL | 1.7 mL | 3.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
