Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TPEN is a heavy metal chelator. Reacts with both Zn-proteome and Zn-metallothionein (MT) in LLC-PK1 cells; acts as an intracellular chelator of proteomic Zn2+. |
|---|
| Catalog Num | A11980 |
|---|---|
| Formula | C26H28N6 |
| Molecular Weight | 424.54 |
| CAS Number | 16858-02-9 |
| SMILES | C1=CC=NC(=C1)CN(CCN(CC2=CC=CC=N2)CC3=CC=CC=N3)CC4=CC=CC=N4 |
| Synonyms | TPEDA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (181.37 mM) | |
| Water | Insoluble | ||
| Ethanol | 77 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.55 mL | 117.77 mL | 235.55 mL |
| 0.5 mM | 4.71 mL | 23.55 mL | 47.11 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.55 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
