Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Quercetin inhibits many enzyme systems including tyrosine protein kinase, phospholipase A2, phosphodiesterases, mitochondrial ATPase, PI 3-kinase and protein kinase C. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10766 |
|---|---|
| Formula | C15H10O7 |
| Molecular Weight | 302.2 |
| CAS Number | 117-39-5 |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| Synonyms | Sophoretin, Meletin, Quercetine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 56 mg/mL (185.28 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (29.77 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 5 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.09 mL | 165.45 mL | 330.91 mL |
| 0.5 mM | 6.62 mL | 33.09 mL | 66.18 mL |
| 1 mM | 3.31 mL | 16.55 mL | 33.09 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
