(S,S)-Z-FA-FMK
(S,S)-Z-FA-FMK is an irreversible inhibitor of cysteine protease
Loading distributor info...
(S,S)-Z-FA-FMK is an irreversible inhibitor of cysteine protease
Loading distributor info...
| Description | (S,S)-Z-FA-FMK is an irreversible inhibitor of cysteine protease |
|---|
| Catalog Num | A16381 |
|---|---|
| Formula | C21H23N2O4F |
| Molecular Weight | 386.42 |
| CAS Number | 105637-38-5 |
| SMILES | CC(C(=O)CF)NC(=O)C(CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
| Synonyms | Z-Phe-Ala-fluoromethyl ketone, Z-Phe-Ala-FMK, Zfa-FMK, Z-Phe-Ala-CH2F, Cathepsin B, Caspase Inhibitor |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2