Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cytarabine hydrochloride, a nucleoside analog, causes S phase cell cycle arrest and inhibits DNA polymerase. Cytarabine inhibits DNA synthesis with an IC50 of 16 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17692 |
|---|---|
| Formula | C9H14ClN3O5 |
| Molecular Weight | 279.68 |
| CAS Number | 69-74-9 |
| SMILES | O=C1N=C(N)C=CN1[C@H]2[C@H]([C@@H]([C@@H](CO)O2)O)O.Cl |
| Synonyms | Cytosine β-D-arabinofuranoside hydrochloride; Cytosine Arabinoside hydrochloride; Ara-C hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (175.2 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.76 mL | 178.78 mL | 357.55 mL |
| 0.5 mM | 7.15 mL | 35.76 mL | 71.51 mL |
| 1 mM | 3.58 mL | 17.88 mL | 35.76 mL |
| 5 mM | 0.72 mL | 3.58 mL | 7.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
