PROTAC

Items 3551-3600 of 5610

Page
per page
Set Descending Direction
Catalog No.
Product Name
Application
Product Information
Citations
  1. PROTAC Linker

    Fmoc-PEG6-NHS ester is a polyethylene glycol (PEG)-derived linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). It facilitates the conjugation of E3 ligase ligands with target proteins, enabling targeted protein degradation. This compound is essential for research in pharmacology, particularly in the development of innovative therapeutic strategies that leverage the ubiquitin-proteasome system.
  2. PROTAC Linker

    N-(Mal-PEG6)-N-bis(PEG7-TCO) is a PEG-based linker specifically designed for PROTAC synthesis. This compound features a TCO moiety that facilitates the inverse electron demand Diels-Alder reaction (iEDDA) with tetrazine-containing molecules, enabling effective targeting and degradation of proteins. It is widely used in chemical biology to create novel therapeutics and to study protein interactions and degradation pathways.
  3. PROTAC Linker

    2-(1-(Boc)Piperidin-4-yl)-2,2-difluoroacetic acid serves as a versatile PROTAC linker essential for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the recruitment of E3 ubiquitin ligases, enabling targeted degradation of specific proteins within cellular pathways. Its application is crucial in the development of innovative therapeutic strategies for diseases related to protein dysregulation.
  4. PROTAC Linker

    2-(9-Bromononyl)-1,3-dioxolane is a crucial PROTAC linker designed to facilitate the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound provides flexibility and enhances the efficacy of targeted protein degradation applications. Its structural characteristics make it suitable for diverse research endeavors in chemical biology and therapeutic development.
  5. PROTAC Linker

    12-Methoxy-12-oxododecanoic acid functions as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound is instrumental in connecting target ligands with E3 ligase recruiters, enhancing the degradation of specific proteins through the cellular ubiquitin-proteasome system. Its unique structure supports the efficient creation of PROTACs for use in various research applications, including studies on targeted protein degradation and the exploration of therapeutic interventions.
  6. PROTAC Linker

    MeNH-PEG2-NHMe is a polyethylene glycol (PEG) linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This versatile linker facilitates the conjugation of target proteins with E3 ubiquitin ligases, enhancing the specificity and affinity in targeted protein degradation applications. Its structural properties contribute to improved solubility and bioavailability, making it suitable for various biochemical assays and drug discovery research.
  7. PROTAC Linker

    (S,R,S)-AHPC-PEG2-NHS ester is a synthetic linker designed for use in PROTAC (Proteolysis Targeting Chimera) applications. Its structure features an E3 ligase ligand coupled with a polyethylene glycol (PEG) spacer, enhancing solubility in aqueous environments. The reactive NHS ester functional group allows for efficient conjugation with amine-containing compounds, facilitating the development of targeted protein degradation strategies in chemical biology research.
  8. PROTAC Linker

    m-PEG11-Br is a polyethylene glycol (PEG) based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates efficient protein degradation by linking a ligand to an E3 ubiquitin ligase. m-PEG11-Br is essential for the development of novel PROTACs aimed at targeted protein modulation in various biological research applications.
  9. PROTAC Linker

    tert-Butyl (trans-3-formylcyclobutyl)carbamate is a novel PROTAC linker that facilitates the development of Proteolysis Targeting Chimeras (PROTACs). Its unique structure allows for efficient conjugation to E3 ligase ligands and target proteins, promoting targeted ubiquitination and subsequent degradation. This reagent is valuable for researchers investigating protein degradation pathways and therapeutic interventions in various diseases.
  10. PROTAC Linker

    5-(Methylthio)pentan-1-amine serves as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound enables the selective degradation of target proteins by linking them to E3 ligases, thus enhancing targeted therapeutic strategies in drug discovery. Its application in the synthesis of PROTACs supports research in protein degradation pathways and targeted cancer therapies.
  11. PROTAC Linker

    3-(3-(3-Ethoxy-3-oxopropoxy)propoxy)propanoic acid serves as a PROTAC linker, facilitating the construction of proteolysis-targeting chimeras (PROTACs). This compound plays a critical role in the development of targeted protein degradation strategies by enhancing the specificity and efficacy of the PROTACs synthesized using it. Its utility in chemical biology makes it a valuable tool for researchers investigating protein regulation and therapeutic applications.
  12. PROTAC Linker

    4-Bromo-1,1-dimethoxybutane serves as a versatile PROTAC linker, essential for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the recruitment of E3 ligase and target proteins to promote ubiquitination and subsequent degradation. It is valuable in drug discovery and development for studying protein interactions and modulation of biological pathways.
  13. PROTAC Linker

    Ethyl 6-aminohexanoate is a versatile PROTAC linker designed to facilitate the synthesis of proteolysis-targeting chimeras (PROTACs). This compound enhances the stability and efficacy of PROTACs by providing a suitable chemical environment for target protein degradation. It is applicable in various research areas, including drug discovery and targeted protein degradation studies.
  14. PROTAC Linker

    Ph-Bis(C1-N-(C2-NH-Boc)2) is a PROTAC linker designed for enhanced protein degradation through targeted protein removal. Its alkyl chain structure facilitates efficient conjugation with ligands and E3 ligases, enabling the development of effective PROTACs. This compound is essential for researchers investigating targeted protein degradation and interrogating cellular mechanisms associated with protein homeostasis.
  15. PROTAC Linker

    Methyl (4-cyanophenyl)acetate serves as a valuable PROTAC linker, facilitating the synthesis of proteolysis-targeting chimeras (PROTACs). This compound enhances the ability to recruit E3 ligases to target proteins, leading to their ubiquitination and subsequent degradation. Its role in PROTAC development is crucial for advancing studies in targeted protein modulation and exploring therapeutic applications in various disease models.
  16. PROTAC Linker

    PEG10-Tos is a PROTAC linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). Its unique structure enhances the efficiency of target protein degradation by enabling effective recruitment of E3 ligases. This compound is critical in the development of small molecule-based therapeutics that harness the ubiquitin-proteasome system for targeted protein modulation in research applications.
  17. PROTAC Linker

    2-(4-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethyl)piperazin-1-yl)acetic acid dihydrochloride acts as a PROTAC linker, facilitating the development of proteolysis-targeting chimeras. This compound plays a crucial role in the synthesis of PROTACs, enabling targeted protein degradation for various biological applications. Its unique structure allows for effective conjugation with target proteins, making it a valuable reagent in drug discovery and cellular biology research.
  18. PROTAC Linker

    Pimeloylchloride is a versatile PROTAC linker that facilitates the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound effectively connects the target protein and an E3 ligase, enabling the selective degradation of specific proteins within cells. Its application is crucial for research in targeted protein degradation and the development of novel therapeutic strategies.
  19. PROTAC Linker

    19-Methoxy-19-oxononadecanoic acid is a versatile PROTAC linker that facilitates the design and synthesis of proteolysis-targeting chimeras (PROTACs). This compound is instrumental in the selective degradation of target proteins through the harnessing of the ubiquitin-proteasome system. Its application in biochemical research enables the study of targeted protein modulation and therapeutic development.
  20. PROTAC Linker

    16-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexadecanoic acid serves as a linker in the development of PROTACs, facilitating targeted protein degradation. Its long aliphatic chain enhances cellular permeability and optimal interaction with protein targets. This compound is essential for constructing bifunctional molecules that engage E3 ligases and specific proteins, making it a valuable tool in chemical biology and therapeutic development.
  21. PROTAC Linker

    Ethyl 2-(4-(((trifluoromethyl)sulfonyl)oxy)cyclohex-3-en-1-yl)acetate serves as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound's unique structural features enhance the stability and efficiency of PROTACs, making it a valuable tool in targeted protein degradation research. Its application supports advancements in studies aimed at modulating specific protein interactions in various biological contexts.
  22. PROTAC Linker

    14-Mercaptotetradecanoic acid acts as a PROTAC linker, facilitating the construction of proteolysis-targeting chimeras (PROTACs). This compound is essential for enabling targeted protein degradation, which holds significant promise in cancer research and drug discovery. Its application in PROTAC development supports studies aimed at elucidating protein function and therapeutic intervention strategies.
  23. PROTAC Linker

    Boc-Piperidine-piperazine-Cbz is a PROTAC linker utilized in the development of proteolysis-targeting chimeras (PROTACs). This compound plays a crucial role in facilitating the selective degradation of target proteins via the ubiquitin-proteasome system. It is integral for research applications aimed at studying protein regulation, cellular signaling, and targeted therapeutics in various disease contexts.
  24. PROTAC Linker

    Methyl 2-(3-(2-hydroxyethyl)bicyclo[1.1.1]pentan-1-yl)acetate functions as a linker in the development of Proteolysis Targeting Chimeras (PROTACs). This compound facilitates the assembly of bifunctional molecules that recruit target proteins for ubiquitin-mediated degradation. It is crucial for applications in targeted protein degradation research, offering potential therapeutic advancements in various diseases through specific modulation of protein levels.
  25. PROTAC Linker

    tert-Butyl 4-(2-(methylamino)ethyl)piperidine-1-carboxylate is a PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates targeted protein degradation by linking a ligand that binds to the target protein with an E3 ligase recruiter. It serves as a crucial component in the development of novel therapeutic agents aimed at selectively degrading specific proteins involved in various diseases.
  26. PROTAC Linker

    tert-Butyl (4-(piperazin-1-yl)butyl)carbamate serves as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound enables the effective recruitment of E3 ligases to target proteins, enhancing targeted protein degradation. Its application is crucial in chemical biology research for the design and synthesis of novel PROTAC molecules aimed at therapeutic interventions.
  27. PROTAC Linker

    Benzyl (2-(2-bromoethoxy)ethyl)carbamate is a PROTAC linker designed specifically for synthesizing Proteolysis Targeting Chimeras (PROTACs). This compound facilitates the development of novel proteolysis-based therapeutic strategies by promoting targeted degradation of specific proteins within cells. Its application in drug discovery and development enables researchers to explore new avenues for addressing diseases driven by dysregulated proteins.
  28. PROTAC Linker

    Hexane-1,6-diamine dihydrochloride serves as a potent PROTAC linker, facilitating the construction of Proteolysis Targeting Chimeras (PROTACs). This compound enables effective recruitment of E3 ligases to target proteins for ubiquitination and subsequent degradation. Its application in the synthesis of PROTACs makes it a valuable tool for biochemical research, particularly in the study of protein regulation and therapeutic development.
  29. PROTAC Linker

    N-Boc-15-aminopentadecanoic acid is a PROTAC linker characterized by its alkane chain, featuring a terminal carboxylic acid and Boc-protected amino groups. This compound facilitates the synthesis of PROTACs by enabling the formation of stable amide bonds with primary amine groups through reaction with activators like EDC or HATU. The Boc protective group can be deprotected under mild acidic conditions to yield the free amine, thus enhancing the versatility in the development of targeted protein degradation strategies.
  30. PROTAC Linker

    2-(4-Boronophenyl)acetic acid functions as a PROTAC linker, facilitating the design and synthesis of proteolysis-targeting chimeras (PROTACs). This compound is essential for creating bifunctional molecules that induce targeted protein degradation, a key approach in chemical biology and therapeutic development. Its unique boron-containing structure provides specific reactivity, enhancing the efficiency of PROTAC formation. Research applications include cancer therapy, neurodegenerative disease studies, and other areas where precise modulation of protein levels is required.
  31. PROTAC Linker

    tert-Butyl 3-(4-aminophenyl)azetidine-1-carboxylate is a versatile PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the formation of bifunctional molecules that induce targeted protein degradation, providing a valuable tool for drug discovery and development. Its structural characteristics enhance the pharmacological properties of the resulting PROTACs, enabling researchers to explore novel therapeutic strategies in various biological contexts.
  32. PROTAC Linker

    3-Azetidinepropanenitrile, 2,2,2-trifluoroacetate (1:1) is a specialized PROTAC linker designed to facilitate the development of proteolysis-targeting chimeras (PROTACs). Its structural properties enable effective conjugation and enhance target protein degradation, making it valuable in drug discovery and therapeutic research. This compound aids in the synthesis of innovative PROTAC molecules, advancing the field of targeted protein degradation.
  33. PROTAC Linker

    N-(m-PEG4)-N'-(Acid-PEG3)-benzothiazole Cy5 is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the targeted degradation of specific proteins through the recruitment of E3 ubiquitin ligases. Its unique structure enhances solubility and may improve the overall pharmacokinetic properties of PROTAC molecules, making it valuable for studies in targeted protein degradation and therapeutic development.
  34. PROTAC Linker

    Methyl 4-[(piperazin-1-yl)methyl]benzoate serves as a PROTAC linker, facilitating the development of targeted protein degraders. It is integral in the synthesis of PROTACs, enabling precise modulation of protein levels within cells. This compound is essential for researchers investigating targeted protein degradation mechanisms and therapeutic applications in various diseases.
  35. PROTAC Linker

    tert-Butyl 4-((2-hydroxyethoxy)methyl)piperidine-1-carboxylate serves as a PROTAC linker facilitating the development of proteolysis-targeting chimeras. This compound is instrumental in connecting target proteins to E3 ligases, enabling selective degradation pathways in cellular research. Its chemical structure allows for enhanced solubility and stability, crucial for effective application in targeted protein degradation studies.
  36. PROTAC Linker

    tert-Butyl 4-(4-(hydroxymethyl)phenoxy)piperidine-1-carboxylate functions as a PROTAC linker, crucial for the development of proteolysis-targeting chimeras (PROTACs). This compound facilitates the conjugation of target proteins to E3 ligases, enabling targeted degradation in cellular systems. It is useful in studies of protein homeostasis, cellular signaling, and therapeutic applications in targeted protein degradation research.
  37. PROTAC Linker

    13-Hydroxytridecanoic acid is a PROTAC linker that facilitates the synthesis of proteolysis-targeting chimeras (PROTACs). It plays a critical role in improving the efficiency of targeted protein degradation by connecting the ligand that recruits E3 ligases to the target protein. This compound is essential for researchers developing novel therapeutic strategies that modulate protein levels in various biological pathways. Its application is particularly relevant in drug discovery and the study of disease mechanisms.
  38. PROTAC Linker

    Cyclobutane-1,3-dicarboxylic acid functions as a PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs) for targeted protein degradation. This chemical scaffold enhances the design of bifunctional molecules that recruit E3 ligases to specific proteins, thereby promoting their ubiquitination and subsequent degradation. Its application is critical in the study of protein regulation and therapeutic intervention in various diseases, including cancers.
  39. PROTAC Linker

    Propargyl-PEG3-NH-Boc is a PROTAC linker designed to facilitate the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound features a propargyl group and a Boc-protected amine, allowing for efficient conjugation and modularity in PROTAC design. Its application in chemical biology includes enhancing target protein degradation and enabling precise modulation of cellular pathways, making it a valuable tool in drug discovery and development.
  40. PROTAC Linker

    3-(2-Aminoethoxy)propan-1-ol hydrochloride serves as a versatile PROTAC linker for the synthesis of proteolysis-targeting chimeras (PROTACs). It facilitates the conjugation of ligand and E3 ligase components, enhancing the generation of bifunctional molecules that mediate targeted protein degradation. This compound is applicable in drug discovery and development for studying protein turnover in various biological pathways.
  41. PROTAC Linker

    Boc-pyrrolidine-Pip-C2-NH2 is a PROTAC linker designed to facilitate the development of proteolysis-targeting chimeras (PROTACs). This compound enables the conjugation of target proteins with E3 ligases for selective degradation, making it a valuable tool in drug discovery and development. Its application is particularly significant in studies focused on targeted protein degradation and therapeutic interventions in various diseases.
  42. PROTAC Linker

    Boc-NH-C3-O-Propargyl is a versatile PROTAC linker that plays a critical role in the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound facilitates the targeted degradation of specific proteins, enabling researchers to investigate protein function and signaling pathways. Its unique structure supports the design of innovative PROTACs for therapeutic applications, making it a valuable tool in chemical biology and drug discovery.
  43. PROTAC Linker

    Methyl 17-bromoheptadecanoate serves as a PROTAC linker, facilitating the development of targeted protein degraders. Its structure and reactivity make it suitable for incorporating into PROTACs, enabling selective degradation of specific proteins within cellular environments. This compound plays a crucial role in advancing research on targeted therapies and protein modulation.
  44. PROTAC Linker

    1-(2-Hydroxyethyl)piperidine-4-carbonitrile is a PROTAC linker that facilitates the development of proteolysis-targeting chimeras (PROTACs). It provides a flexible and efficient connection between E3 ligase recruiters and target proteins, enhancing the selective degradation of specific substrates. This compound is crucial for research applications focused on targeted protein degradation and the modulation of cellular pathways.
  45. PROTAC Linkers

    1-Piperazinehexanoic acid functions as a PROTAC linker, serving as a crucial intermediate in the synthesis of complex molecular structures, including JMV7048. This compound plays a significant role in protein degradation studies and other applications in targeted protein degradation research. Its unique structure provides effective connectivity for bifunctional molecules used in therapeutic research and drug development.
  46. PROTAC Linker

    1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)piperazine serves as a versatile PROTAC linker, facilitating the development of Protein Degradation Targeting Chimera (PROTAC) molecules. This compound is designed to enhance the stability and efficacy of PROTACs by linking the target protein to an E3 ligase, promoting ubiquitination and subsequent degradation. Its unique structure allows for fine-tuning in drug design, making it a valuable reagent for researchers in the fields of targeted protein degradation and therapeutic development.
  47. PROTAC Linker

    Adipic acid monoethyl ester functions as a PROTAC linker and is integral in the synthesis of PROTAC compounds. This linker enables the formation of bifunctional molecules that target proteins for ubiquitination and subsequent proteasomal degradation. It is a valuable tool for researchers investigating targeted protein degradation mechanisms and developing novel therapeutic strategies.
  48. PROTAC Linker

    Ethyl 3-(4-formylphenyl)propanoate functions as a PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). It enhances the selective degradation of targeted proteins by linking E3 ligases with the target proteins of interest. This compound is valuable in chemical biology research for the advancement of targeted protein degradation technologies.
  49. PROTAC Linker

    4-(Benzyloxycarbonylamino)bicyclo[2.2.2]octane-1-carboxylic acid is a versatile PROTAC linker that facilitates the development of proteolysis-targeting chimeras (PROTACs). This compound enhances the selective degradation of target proteins by providing a stable and efficient linkage between the target ligand and E3 ubiquitin ligase. It is essential for researchers investigating targeted protein degradation and exploring novel therapeutic strategies in cancer and other diseases.
  50. PROTAC Linker

    (S)-Boc-NH-Cy-C-NH2 hydrochloride is a PROTAC linker that facilitates the development of targeted protein degradation molecules. It enables the synthesis of heterobifunctional compounds for the modulation of protein-protein interactions. This compound is essential in research aimed at exploring innovative therapeutic strategies in oncology and other disease areas, where targeted degradation of specific proteins is beneficial.

Items 3551-3600 of 5610

Page
per page
Set Descending Direction