Catalog No.
Product Name
Application
Product Information
Citations
-
PROTAC linker
Alkyne-ethyl-PEG1-Boc is a PEG-based PROTAC linker that facilitates the synthesis of proteolysis-targeting chimeras (PROTACs). This compound features an alkyne moiety, enabling copper-catalyzed azide-alkyne cycloaddition (CuAAC) with azide-containing molecules. Its application in PROTAC development supports targeted protein degradation studies and drug discovery research. -
PROTAC Linker
Boc-NHCH2CH2-PEG1-azide is a PEG-based linker specifically designed for use in synthesizing PROTACs (Proteolysis Targeting Chimeras). This compound features an azide group that enables it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with entities containing DBCO or BCN groups, facilitating the development of targeted protein degradation strategies in chemical research. -
PROTAC Linker
S-acetyl-PEG4-NHBoc is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of target proteins with E3 ligases, effectively promoting targeted degradation. S-acetyl-PEG4-NHBoc is particularly valuable in research applications focused on protein regulation and therapeutic development through targeted protein degradation strategies. -
PROTAC Linkers
Boc-Aminooxy-PEG3-thiol is a PEG-based linker designed for use in the synthesis of PROTACs (proteolysis-targeting chimeras). It contains an aminooxy group that facilitates the formation of covalent bonds with targeted proteins, enabling targeted degradation through the ubiquitin-proteasome pathway. This compound is essential for researchers focusing on novel therapeutic strategies involving protein modulation and selective degradation in cellular studies. -
PROTAC Linker
N,N'-DME-N,N'-Bis-PEG2-acid is a PEG-based linker designed for the synthesis of PROTAC (Proteolysis Targeting Chimeras) molecules. This compound facilitates the selective degradation of target proteins by promoting ubiquitination and subsequent proteasomal degradation. Its application extends to various fields of research focused on targeted protein degradation, offering a valuable tool for studying protein function and developing therapeutic strategies. -
PROTAC Linker
Benzyl-PEG1-propanol serves as a PEG-based linker for PROTAC (Proteolysis Targeting Chimeras) applications. This compound facilitates the synthesis of PROTACs by providing a flexible and hydrophilic connection that enhances solubility and biocompatibility. Its key role in the development of targeted protein degradation strategies makes it a valuable tool for chemical biology research, particularly in studies related to protein modulation and therapeutic development. -
PROTAC Linkers
Benzyl-PEG6-THP is a polyethylene glycol (PEG) based linker designed for PROTAC (Proteolysis Targeting Chimera) applications. This compound facilitates the synthesis of PROTACs by providing flexibility and hydrophilicity, essential for optimizing target protein degradation. Its structure allows efficient conjugation with various protein ligands, enabling researchers to explore targeted protein modulation in cellular studies. -
PROTAC Linker
m-PEG10-Tos is a polyethylene glycol (PEG)-based linker designed for the synthesis of PROTACs (proteolysis-targeting chimeras). This compound facilitates the development of bifunctional molecules that promote targeted degradation of specific proteins via the ubiquitin-proteasome system. Its unique PEGylation properties enhance solubility and optimize pharmacokinetic profiles, making it a valuable tool for researchers in drug discovery and development. -
PROTAC Linker
Azido-PEG3-CH2CO2Me is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). It features an azide functional group, enabling it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) and strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with alkyne-containing molecules. This versatility allows Azido-PEG3-CH2CO2Me to facilitate the formation of complex biomolecular conjugates, making it a valuable tool in targeted protein degradation research and various bioconjugation applications. -
PROTAC Linker
Chloroacetamido-C-PEG3-C3-NHBoc is a PEG-based linker designed for the synthesis of PROTACs (proteolysis-targeting chimeras). This compound facilitates the conjugation of target proteins to E3 ligases, enabling targeted protein degradation. It plays a crucial role in the development of novel therapeutics and is widely used in chemical biology and drug discovery applications. -
PROTAC Linkers
Benzyl-PEG6-amine is a PEG-based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the selective degradation of target proteins by linking target ligands to E3 ligase recruiters. Its unique chemical structure allows for improved solubility and stability, making it an essential reagent in chemical biology and therapeutic research focused on targeted protein degradation. -
PROTAC Linkers
PEG3-bis(phosphonic acid) serves as a PEG-based linker in the development of PROTACs (Proteolysis Targeting Chimeras). Its structure facilitates the conjugation of target proteins to E3 ubiquitin ligases, thereby promoting targeted protein degradation. This compound is essential in research applications focused on therapeutic interventions via the modulation of protein levels within cells. -
PROTAC Linkers
DBCO-NHCO-PEG13-NHS ester is a PEG-based PROTAC linker designed for the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound features a DBCO group that facilitates strain-promoted alkyne-azide cycloaddition (SPAAC) with azide-containing molecules, enabling the efficient formation of covalent linkages. Its application in PROTAC development supports targeted protein degradation studies, making it a valuable tool in chemical biology and drug discovery research. -
PROTAC Linker
Benzyl-PEG2-ethanol is a PEG-based linker designed for the synthesis of PROTACs (Proteolysis-targeting chimeras). This compound enhances the solubility and stability of PROTAC molecules, facilitating efficient target protein degradation. Its application in chemical biology allows for the development of novel therapeutic agents that exploit the ubiquitin-proteasome system for targeted protein modulation. -
PROTAC Linker
Boc-NH-PEG6-azide is a PEG-based linker designed for use in PROTAC (proteolysis-targeting chimera) synthesis. This compound features an azide group, enabling it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-containing molecules. Additionally, Boc-NH-PEG6-azide is capable of undergoing strain-promoted alkyne-azide cycloaddition (SPAAC) with constructs containing DBCO or BCN groups. Its applications are pivotal in the development of targeted protein degradation strategies. -
PROTAC Linker
Tos-PEG12-Tos is a polyethylene glycol (PEG)-based PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound enhances the solubility and efficacy of PROTAC molecules, facilitating targeted protein degradation. Its unique structure allows for flexible and tunable linkages, making it suitable for a range of biological applications in drug development and research. -
PROTAC Linkers
Acid-PEG13-NHS ester is a PEGylated linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of target proteins to E3 ligases, enabling targeted protein degradation. Its extended polyethylene glycol (PEG) chain enhances solubility and stability, making it suitable for various biological applications in drug development and protein engineering. -
PROTAC linker
N-(Azido-PEG3)-N-Boc-PEG3-NHS ester is a PEG-based PROTAC linker that facilitates the synthesis of targeted protein degraders. This compound functions as a click chemistry reagent, featuring an azide group that participates in copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) with DBCO or BCN-functionalized compounds. These properties make it a valuable tool in chemical biology and drug discovery research. -
PROTAC Linker
Azido-PEG1-C2-methylamine is a PEG-based linker specifically designed for use in the synthesis of PROTACs (proteolysis-targeting chimeras). This compound features an azide functionality, facilitating copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules, as well as strain-promoted alkyne-azide cycloaddition (SPAAC) with DBCO or BCN moieties. Its versatile click chemistry properties make it an invaluable tool in targeted protein degradation research and the development of innovative therapeutic strategies. -
PROTAC Linker
I-PEG6-OH is a polyethylene glycol (PEG)-based linker designed for the synthesis of PROTACs (proteolysis targeting chimeras). It facilitates the construction of PROTACs by enabling the effective conjugation of targeting moieties to E3 ligase recruiters. This linker enhances the solubility and stability of the resulting compounds, making it valuable for studies in targeted protein degradation and drug discovery research. -
PROTAC Linker
Propargyl-PEG4-tetra-Ac-beta-D-glucose is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of PROTAC (Proteolysis Targeting Chimeras). This compound facilitates the targeted degradation of proteins by linking E3 ligases to substrate proteins, enabling selective modulation of biological pathways. Its role as a versatile PROTAC linker makes it valuable for research applications in drug discovery and development of therapeutics aimed at regulating protein levels. -
PROTAC Linker
Mal-PEG3-alcohol is a polyethylene glycol (PEG)-based PROTAC linker that facilitates the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound is essential for creating bifunctional molecules that harness the ubiquitin-proteasome system to selectively degrade target proteins. Mal-PEG3-alcohol serves to enhance the solubility and biocompatibility of PROTACs, making it a valuable tool in drug discovery and development research. -
PROTAC Linker
Propargyl-PEG4-beta-D-glucose is a PEG-based linker designed for use in the synthesis of PROTACs (proteolysis targeting chimeras). This compound facilitates the conjugation of ligands to E3 ubiquitin ligases, enabling targeted degradation of specific proteins. Its unique structure allows for improved solubility and cellular permeability, making it a valuable tool in drug discovery and development research, particularly in the field of targeted protein modulation. -
PROTAC Linkers
Boc-Aminooxy-PEG3-bromide is a polyethylene glycol (PEG)-based linker designed for PROTAC (Proteolysis Targeting Chimera) synthesis. This compound features a Boc-protected aminooxy group, facilitating the conjugation of target proteins for enhanced proteasome-mediated degradation. It serves a critical role in the development of targeted protein degradation strategies, enabling diverse applications in drug discovery and cellular biology research. -
PROTAC Linker
1-(2-Chloro-acetyl)-piperazine is a key PROTAC linker that facilitates the targeted degradation of specific proteins. This compound serves as an essential building block in the synthesis of PROTAC TEAD1/IAP degrader-2, enabling research into pathways regulated by TEAD transcription factors. Its role in the development of protein degraders supports advancements in cancer research and therapeutic applications aimed at protein modulation. -
PROTAC Linker
Benzyl-PEG6-bromide is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of protein ligands to E3 ligases, enabling targeted protein degradation. Its application in PROTAC development offers significant potential for innovative therapeutic strategies in drug discovery and cancer research. -
PROTAC Linker
Azido-PEG5-CH2CO2-PFP is a PEG-based PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound features an azide functional group, enabling it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) and strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with alkyne-containing molecules or those carrying DBCO/BCN groups. Its robust reactivity makes it an essential tool for advancing research in targeted protein degradation. -
PROTAC Linker
N-(Azido-PEG3)-N-bis(PEG3-Boc) functions as a PEG-based linker for PROTAC synthesis, facilitating targeted protein degradation. This compound features an azide group that enables copper-catalyzed azide-alkyne cycloaddition and strain-promoted alkyne-azide cycloaddition with molecules containing alkyne, DBCO, or BCN groups. Its versatile reactivity makes it an invaluable tool in chemical biology and drug discovery applications, particularly in developing novel PROTACs for therapeutic interventions. -
PROTAC Linker
Fmoc-N-PEG3-CH2-NHS ester is a PEG-based linker designed for use in the synthesis of PROTAC (Proteolysis Targeting Chimeras) molecules. This compound facilitates the conjugation of target proteins to E3 ligases, enabling targeted degradation pathways in cellular studies. Its specific design allows for enhanced solubility and flexibility in bioconjugation, making it a valuable tool in drug discovery and development research focusing on targeted therapeutics. -
PROTAC Linker
Br-PEG3-CH2COOH is a PEG-based linker designed for use in the synthesis of PROTACs (proteolysis targeting chimeras). This compound facilitates the formation of bifunctional molecules that can selectively induce the degradation of specific target proteins via the ubiquitin-proteasome system. It serves as a critical component in research applications focused on targeted protein degradation and therapeutic development. -
PROTAC Linkers
Methylamino-PEG3-t-butyl ester is a polyethylene glycol (PEG) based linker designed for the synthesis of PROTACs (proteolysis-targeting chimeras). This compound facilitates targeted protein degradation by connecting an E3 ligase ligand to a protein of interest. Its application in PROTAC development makes it essential for researchers studying protein regulation and potential therapeutic interventions in various diseases. -
PROTAC Linker
Propargyl-PEG5-1-o-(b-cyanoethyl-n,n-diisopropyl)phosphoramidite functions as a PEG-based linker for protein degradation technologies, specifically PROTAC synthesis. This compound includes an alkyne functionality that facilitates copper-catalyzed azide-alkyne cycloaddition (CuAAc), enabling efficient conjugation with azide-containing partners. It is suitable for applications in targeted protein degradation studies and offers versatility in the development of innovative therapeutic modalities. -
PROTAC Linker
m-PEG3-Sulfone-PEG3-Boc is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound contains a sulfone group, enhancing solubility and stability in biological systems. Its primary application lies in facilitating the development of PROTACs for targeted protein degradation studies, offering researchers a valuable tool for investigating protein function and therapeutic intervention. -
PROTAC Linker
Diethyl 8-bromooctylphosphonate acts as a versatile linker in the synthesis of PROTACs (proteolysis-targeting chimeras). Its alkyl chain structure facilitates the development of bifunctional molecules that engage target proteins for ubiquitination and subsequent degradation. This compound is essential for research focused on targeted protein degradation and the modulation of cellular pathways through innovative therapeutic strategies. -
PROTAC Linker
N-(m-PEG4)-N'-(PEG2-acid)-Cy5 is a polyethylene glycol (PEG)-based linker designed for use in the development of PROTACs (proteolysis-targeting chimeras). This compound facilitates the design and synthesis of PROTACs by enhancing solubility and target specificity. Its versatile properties enable researchers to effectively study targeted protein degradation pathways and explore novel therapeutic strategies. -
PROTAC Linker
Azido-PEG3-S-PEG4-t-butyl ester serves as a versatile PEG-based linker for the synthesis of PROTACs, facilitating targeted protein degradation. Featuring an azide functional group, this compound is capable of undergoing copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN moieties, making it valuable for applications in chemical biology and therapeutic development. -
PROTAC Linker
Boc-PEG2-ethoxyethane-PEG2-benzyl is a polyethylene glycol (PEG)-based linker designed specifically for the synthesis of proteolysis targeting chimeras (PROTACs). This compound facilitates the recruitment of E3 ligases to target proteins, enhancing proteolytic degradation pathways. Its biocompatibility and flexibility make it an essential component in the development of novel therapeutic agents aimed at targeted protein degradation. -
PROTAC Linker
C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a PEG-based linker specifically designed for the development of PROTAC (Proteolysis Targeting Chimeras). This compound facilitates the effective conjugation of ligands to E3 ligase, enhancing the selective ubiquitination and degradation of target proteins. Its unique structure promotes water solubility and optimal spatial orientation, making it suitable for various applications in targeted protein degradation research. -
PROTAC Linker
tert-Butyl ((3-(aminomethyl)cyclobutyl)methyl)carbamate functions as a PROTAC linker facilitating the targeted degradation of proteins via the ubiquitin-proteasome pathway. This compound is instrumental in the development of PROTACs, enabling selective modulation and degradation of intracellular proteins. Its application is critical in the field of targeted protein therapy and research in protein homeostasis and regulation. -
PROTAC Linker
N-(Azido-PEG2)-N-Fluorescein-PEG3-acid is a bifunctional PEG-based linker designed for PROTAC synthesis. This compound features an azide moiety that enables copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing partners. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN functionalized molecules. The incorporation of fluorescein facilitates the assessment of conjugation efficiency, enhancing its utility in chemical biology and targeted protein degradation studies. -
PROTAC Linker
N-(Azido-PEG2)-N-Boc-PEG3-acid is a PEG-based PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound contains an azide moiety that enables it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-containing partners. Additionally, it can facilitate strain-promoted alkyne-azide cycloaddition (SPAAC) with dibenzocyclooctyne (DBCO) or bicyclononyne (BCN) groups, expanding its utility in bioconjugation processes in chemical biology research. -
PROTAC Linkers
Boc-Nonanol is a PROTAC linker designed for targeted protein degradation applications. It plays a crucial role in the synthesis of PROTAC TRIB2 degrader-1, facilitating the development of novel therapeutics targeting specific proteins for degradation. With its versatile functional group, Boc-Nonanol enhances the efficacy of PROTAC-based strategies in chemical biology research. -
PROTAC Linkers
Azido-PEG1-CH2COO-Cl is a versatile PROTAC linker that facilitates targeted protein degradation by connecting E3 ligases with specific target proteins. This linker is critical for the synthesis of compounds such as PROTAC BRD4 Degrader-1. Featuring an azide functional group, Azido-PEG1-CH2COO-Cl participates in copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) and strain-promoted alkyne-azide cycloaddition (SPAAC) with alkyne and DBCO or BCN-modified molecules, respectively. Its unique reactivity makes it an essential tool in chemical biology and therapeutic development. -
PROTAC Linker
4-Piperidineethanol-piperidine-Boc is a PROTAC linker designed for targeted protein degradation applications. It serves as a crucial component in the synthesis of PROTAC BRD4 Degrader-31, facilitating the selective degradation of the BRD4 protein. This compound is valuable in studies exploring the inhibition of gene transcription and therapeutic strategies in oncology and other disease areas. -
PROTAC Linkers
t-Boc-Aminooxy-PEG3-alcohol is a PEG-based linker designed for use in the synthesis of PROTAC (PROteolysis TArgeting Chimeras) compounds. Its aminooxy group facilitates selective conjugation to target proteins, enabling the development of bifunctional molecules that direct E3 ligase-mediated protein degradation. This linker is valuable for researchers seeking to explore targeted protein modulation and therapeutic applications in the field of targeted protein degradation. -
PROTAC Linker
PEG3-bis(phosphonic acid diethyl ester) serves as a PEG-based linker for PROTAC (Proteolysis Targeting Chimeras) development. This compound facilitates the synthesis of PROTACs, which are designed to selectively target and degrade specific proteins within cells. Its application in chemical research is vital for the advancement of targeted protein degradation therapies and the study of protein function. -
PROTAC Linkers
Boc-N-Amido-PEG2-C2-azide is a PEG-based PROTAC linker designed for the synthesis of targeted protein degradation agents. This compound contains an azide group that facilitates copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-functionalized molecules, enhancing conjugation efficiency. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN groups, making it suitable for diverse bioconjugation applications in chemical biology and drug discovery. -
PROTAC Linker
Aminooxy-PEG3-methyl ester is a polyethylene glycol (PEG)-based linker designed for use in PROTAC (proteolysis-targeting chimera) synthesis. This compound facilitates optimal conjugation of targeting ligands to E3 ligase ligands, enhancing the efficacy of targeted protein degradation applications. It is suitable for research in drug discovery, particularly in the development of therapeutics that harness the cellular ubiquitin-proteasome system for controlled protein turnover. -
PROTAC Linker
Boc-NH-PEG3-sulfonic acid is a PEG-based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the formation of stable PROTACs, enabling targeted degradation of specific proteins within cells. Its sulfonic acid group enhances solubility and biocompatibility, making it suitable for various biological assays and therapeutic applications in drug discovery and development. -
PROTAC linker
N-(Azido-PEG3)-N-Boc-PEG3-t-butyl ester is a PEG-based linker designed for the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound features an azide functional group that enables copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing partners, as well as strain-promoted alkyne-azide cycloaddition (SPAAC) with DBCO or BCN groups. Its properties facilitate the development of targeted degradation strategies in chemical biology and therapeutic research.

