Catalog No.
Product Name
Application
Product Information
Citations
-
PROTAC Linker
Propargyl-PEG4-beta-D-glucose is a PEG-based linker designed for use in the synthesis of PROTACs (proteolysis targeting chimeras). This compound facilitates the conjugation of ligands to E3 ubiquitin ligases, enabling targeted degradation of specific proteins. Its unique structure allows for improved solubility and cellular permeability, making it a valuable tool in drug discovery and development research, particularly in the field of targeted protein modulation. -
PROTAC Linkers
Boc-Aminooxy-PEG3-bromide is a polyethylene glycol (PEG)-based linker designed for PROTAC (Proteolysis Targeting Chimera) synthesis. This compound features a Boc-protected aminooxy group, facilitating the conjugation of target proteins for enhanced proteasome-mediated degradation. It serves a critical role in the development of targeted protein degradation strategies, enabling diverse applications in drug discovery and cellular biology research. -
PROTAC Linker
1-(2-Chloro-acetyl)-piperazine is a key PROTAC linker that facilitates the targeted degradation of specific proteins. This compound serves as an essential building block in the synthesis of PROTAC TEAD1/IAP degrader-2, enabling research into pathways regulated by TEAD transcription factors. Its role in the development of protein degraders supports advancements in cancer research and therapeutic applications aimed at protein modulation. -
PROTAC Linker
Benzyl-PEG6-bromide is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of protein ligands to E3 ligases, enabling targeted protein degradation. Its application in PROTAC development offers significant potential for innovative therapeutic strategies in drug discovery and cancer research. -
PROTAC Linker
Azido-PEG5-CH2CO2-PFP is a PEG-based PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound features an azide functional group, enabling it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) and strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with alkyne-containing molecules or those carrying DBCO/BCN groups. Its robust reactivity makes it an essential tool for advancing research in targeted protein degradation. -
PROTAC Linker
N-(Azido-PEG3)-N-bis(PEG3-Boc) functions as a PEG-based linker for PROTAC synthesis, facilitating targeted protein degradation. This compound features an azide group that enables copper-catalyzed azide-alkyne cycloaddition and strain-promoted alkyne-azide cycloaddition with molecules containing alkyne, DBCO, or BCN groups. Its versatile reactivity makes it an invaluable tool in chemical biology and drug discovery applications, particularly in developing novel PROTACs for therapeutic interventions. -
PROTAC Linker
Fmoc-N-PEG3-CH2-NHS ester is a PEG-based linker designed for use in the synthesis of PROTAC (Proteolysis Targeting Chimeras) molecules. This compound facilitates the conjugation of target proteins to E3 ligases, enabling targeted degradation pathways in cellular studies. Its specific design allows for enhanced solubility and flexibility in bioconjugation, making it a valuable tool in drug discovery and development research focusing on targeted therapeutics. -
PROTAC Linker
Br-PEG3-CH2COOH is a PEG-based linker designed for use in the synthesis of PROTACs (proteolysis targeting chimeras). This compound facilitates the formation of bifunctional molecules that can selectively induce the degradation of specific target proteins via the ubiquitin-proteasome system. It serves as a critical component in research applications focused on targeted protein degradation and therapeutic development. -
PROTAC Linkers
Methylamino-PEG3-t-butyl ester is a polyethylene glycol (PEG) based linker designed for the synthesis of PROTACs (proteolysis-targeting chimeras). This compound facilitates targeted protein degradation by connecting an E3 ligase ligand to a protein of interest. Its application in PROTAC development makes it essential for researchers studying protein regulation and potential therapeutic interventions in various diseases. -
PROTAC Linker
Propargyl-PEG5-1-o-(b-cyanoethyl-n,n-diisopropyl)phosphoramidite functions as a PEG-based linker for protein degradation technologies, specifically PROTAC synthesis. This compound includes an alkyne functionality that facilitates copper-catalyzed azide-alkyne cycloaddition (CuAAc), enabling efficient conjugation with azide-containing partners. It is suitable for applications in targeted protein degradation studies and offers versatility in the development of innovative therapeutic modalities. -
PROTAC Linker
m-PEG3-Sulfone-PEG3-Boc is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound contains a sulfone group, enhancing solubility and stability in biological systems. Its primary application lies in facilitating the development of PROTACs for targeted protein degradation studies, offering researchers a valuable tool for investigating protein function and therapeutic intervention. -
PROTAC Linker
Diethyl 8-bromooctylphosphonate acts as a versatile linker in the synthesis of PROTACs (proteolysis-targeting chimeras). Its alkyl chain structure facilitates the development of bifunctional molecules that engage target proteins for ubiquitination and subsequent degradation. This compound is essential for research focused on targeted protein degradation and the modulation of cellular pathways through innovative therapeutic strategies. -
PROTAC Linker
N-(m-PEG4)-N'-(PEG2-acid)-Cy5 is a polyethylene glycol (PEG)-based linker designed for use in the development of PROTACs (proteolysis-targeting chimeras). This compound facilitates the design and synthesis of PROTACs by enhancing solubility and target specificity. Its versatile properties enable researchers to effectively study targeted protein degradation pathways and explore novel therapeutic strategies. -
PROTAC Linker
Azido-PEG3-S-PEG4-t-butyl ester serves as a versatile PEG-based linker for the synthesis of PROTACs, facilitating targeted protein degradation. Featuring an azide functional group, this compound is capable of undergoing copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN moieties, making it valuable for applications in chemical biology and therapeutic development. -
PROTAC Linker
Boc-PEG2-ethoxyethane-PEG2-benzyl is a polyethylene glycol (PEG)-based linker designed specifically for the synthesis of proteolysis targeting chimeras (PROTACs). This compound facilitates the recruitment of E3 ligases to target proteins, enhancing proteolytic degradation pathways. Its biocompatibility and flexibility make it an essential component in the development of novel therapeutic agents aimed at targeted protein degradation. -
PROTAC Linker
C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a PEG-based linker specifically designed for the development of PROTAC (Proteolysis Targeting Chimeras). This compound facilitates the effective conjugation of ligands to E3 ligase, enhancing the selective ubiquitination and degradation of target proteins. Its unique structure promotes water solubility and optimal spatial orientation, making it suitable for various applications in targeted protein degradation research. -
PROTAC Linker
tert-Butyl ((3-(aminomethyl)cyclobutyl)methyl)carbamate functions as a PROTAC linker facilitating the targeted degradation of proteins via the ubiquitin-proteasome pathway. This compound is instrumental in the development of PROTACs, enabling selective modulation and degradation of intracellular proteins. Its application is critical in the field of targeted protein therapy and research in protein homeostasis and regulation. -
PROTAC Linker
N-(Azido-PEG2)-N-Fluorescein-PEG3-acid is a bifunctional PEG-based linker designed for PROTAC synthesis. This compound features an azide moiety that enables copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing partners. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN functionalized molecules. The incorporation of fluorescein facilitates the assessment of conjugation efficiency, enhancing its utility in chemical biology and targeted protein degradation studies. -
PROTAC Linker
N-(Azido-PEG2)-N-Boc-PEG3-acid is a PEG-based PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound contains an azide moiety that enables it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-containing partners. Additionally, it can facilitate strain-promoted alkyne-azide cycloaddition (SPAAC) with dibenzocyclooctyne (DBCO) or bicyclononyne (BCN) groups, expanding its utility in bioconjugation processes in chemical biology research. -
PROTAC Linkers
Boc-Nonanol is a PROTAC linker designed for targeted protein degradation applications. It plays a crucial role in the synthesis of PROTAC TRIB2 degrader-1, facilitating the development of novel therapeutics targeting specific proteins for degradation. With its versatile functional group, Boc-Nonanol enhances the efficacy of PROTAC-based strategies in chemical biology research. -
PROTAC Linkers
Azido-PEG1-CH2COO-Cl is a versatile PROTAC linker that facilitates targeted protein degradation by connecting E3 ligases with specific target proteins. This linker is critical for the synthesis of compounds such as PROTAC BRD4 Degrader-1. Featuring an azide functional group, Azido-PEG1-CH2COO-Cl participates in copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) and strain-promoted alkyne-azide cycloaddition (SPAAC) with alkyne and DBCO or BCN-modified molecules, respectively. Its unique reactivity makes it an essential tool in chemical biology and therapeutic development. -
PROTAC Linker
4-Piperidineethanol-piperidine-Boc is a PROTAC linker designed for targeted protein degradation applications. It serves as a crucial component in the synthesis of PROTAC BRD4 Degrader-31, facilitating the selective degradation of the BRD4 protein. This compound is valuable in studies exploring the inhibition of gene transcription and therapeutic strategies in oncology and other disease areas. -
PROTAC Linkers
t-Boc-Aminooxy-PEG3-alcohol is a PEG-based linker designed for use in the synthesis of PROTAC (PROteolysis TArgeting Chimeras) compounds. Its aminooxy group facilitates selective conjugation to target proteins, enabling the development of bifunctional molecules that direct E3 ligase-mediated protein degradation. This linker is valuable for researchers seeking to explore targeted protein modulation and therapeutic applications in the field of targeted protein degradation. -
PROTAC Linker
PEG3-bis(phosphonic acid diethyl ester) serves as a PEG-based linker for PROTAC (Proteolysis Targeting Chimeras) development. This compound facilitates the synthesis of PROTACs, which are designed to selectively target and degrade specific proteins within cells. Its application in chemical research is vital for the advancement of targeted protein degradation therapies and the study of protein function. -
PROTAC Linkers
Boc-N-Amido-PEG2-C2-azide is a PEG-based PROTAC linker designed for the synthesis of targeted protein degradation agents. This compound contains an azide group that facilitates copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-functionalized molecules, enhancing conjugation efficiency. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN groups, making it suitable for diverse bioconjugation applications in chemical biology and drug discovery. -
PROTAC Linker
Aminooxy-PEG3-methyl ester is a polyethylene glycol (PEG)-based linker designed for use in PROTAC (proteolysis-targeting chimera) synthesis. This compound facilitates optimal conjugation of targeting ligands to E3 ligase ligands, enhancing the efficacy of targeted protein degradation applications. It is suitable for research in drug discovery, particularly in the development of therapeutics that harness the cellular ubiquitin-proteasome system for controlled protein turnover. -
PROTAC Linker
Boc-NH-PEG3-sulfonic acid is a PEG-based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the formation of stable PROTACs, enabling targeted degradation of specific proteins within cells. Its sulfonic acid group enhances solubility and biocompatibility, making it suitable for various biological assays and therapeutic applications in drug discovery and development. -
PROTAC linker
N-(Azido-PEG3)-N-Boc-PEG3-t-butyl ester is a PEG-based linker designed for the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound features an azide functional group that enables copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing partners, as well as strain-promoted alkyne-azide cycloaddition (SPAAC) with DBCO or BCN groups. Its properties facilitate the development of targeted degradation strategies in chemical biology and therapeutic research. -
PROTAC Linker
Boc-PEG8-Boc is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the construction of heterobifunctional molecules by connecting E3 ligases with target proteins, thereby promoting targeted protein degradation. It can be applied in research focused on drug discovery and development, particularly in studies aimed at selectively eliminating disease-associated proteins. -
PROTAC Linkers
Thiol-PEG3-NHBoc is a PEG-based linker designed for use in PROTAC (Proteolysis Targeting Chimera) synthesis. This compound facilitates the conjugation of a target ligand to an E3 ligase ligand, enabling targeted protein degradation. Thiol-PEG3-NHBoc plays a critical role in the development of innovative therapeutic strategies aimed at modulating protein levels within various cellular contexts. -
PROTAC Linker
Azido-PEG20-alcohol is a PEG-based linker designed for use in the synthesis of PROTACs. Its azide functional group facilitates copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing compounds, as well as strain-promoted alkyne-azide cycloaddition (SPAAC) with DBCO or BCN moieties. This compound is valuable for researchers studying targeted protein degradation and protein-protein interactions, enabling the development of innovative biopharmaceuticals. -
PROTAC Linkers
t-Boc-Aminooxy-PEG4-amine is a polyethylene glycol (PEG) based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound features an aminooxy functional group that facilitates the conjugation of ligands to target proteins, enabling the degradation of specific proteins via the ubiquitin-proteasome system. Its key biological activity makes it suitable for applications in targeted protein degradation research, providing a versatile tool for drug discovery and development. -
PROTAC Linkers
(1r,4r)-tert-Butyl 4-(bromomethyl)cyclohexanecarboxylate serves as a pivotal PROTAC linker, facilitating the development of targeted protein degradation strategies. Its chemical structure enables effective conjugation to protein moieties, enhancing the specificity and efficacy of PROTACs. This compound is instrumental in research applications focused on innovative therapeutic approaches, particularly in the fields of oncology and cellular biology. -
PROTAC Linker
APN-NH2 is an alkyl chain-based PROTAC linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound features an alkyne group and is suitable for copper-catalyzed azide-alkyne cycloaddition (CuAAc) with azide-containing molecules. Its biological activity supports the development of novel therapeutics by enabling targeted protein degradation, making it a valuable tool in chemical biology research. -
PROTAC Linker
Ald-Ph-amido-PEG2-C2-acid is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the selective degradation of target proteins through the ubiquitin-proteasome pathway, enhancing the therapeutic potential of PROTACs in various biological studies. It is essential for researchers engaged in drug discovery and development, particularly in the field of targeted protein degradation. -
PROTAC Linker
Mal-PEG5-PFP ester is a polyethylene glycol (PEG)-based linker specifically designed for use in PROTAC (Proteolysis Targeting Chimeras) synthesis. This compound facilitates the development of targeted protein degradation strategies by linking the E3 ligase and the target protein. It is a valuable reagent for researchers investigating novel therapeutic approaches in cancer and other diseases through controlled protein degradation. -
PROTAC Linker
Boc-aminooxy-PEG5-propargyl is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound features an alkyne functional group, enabling it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with azide-containing molecules. Its unique properties make it suitable for targeted protein degradation research and the development of novel therapeutic agents in chemical biology. -
PROTAC Linker
Boc-Aminooxy-PEG4-CH2-Boc is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the targeted degradation of specific proteins by linking E3 ligase recruiters to protein targets, enhancing the efficacy of protein degradation pathways. It is a valuable tool for researchers exploring targeted protein modulation and therapeutic development in various disease contexts. -
PROTAC Linkers
Azidoethyl-SS-PEG2-Boc is a PEG-based PROTAC linker that facilitates the synthesis of PROTACs through its reactive azide group. This reagent is designed for click chemistry applications, enabling copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it supports strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with dibenzocyclooctyne (DBCO) or bicyclononyne (BCN) functionalized compounds. Its versatile functionality makes Azidoethyl-SS-PEG2-Boc an essential tool in the development of targeted protein degradation strategies. -
PROTAC Linkers
Bis-(m-PEG8-amido)-hexanoic acid is a polyethylene glycol (PEG)-based linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the targeted degradation of specific proteins by promoting their ubiquitination and subsequent proteasomal degradation. Its application in PROTAC development enables researchers to explore innovative therapeutic strategies in cancer and other diseases by modulating protein levels in a highly specific manner. -
PROTAC Linker
1,1,1-Trifluoroethyl-PEG4-Tos is a polyethylene glycol (PEG) based linker designed for proteolysis-targeting chimeras (PROTACs). It enhances the stability and solubility of PROTACs, facilitating the targeted degradation of specific proteins. This compound is essential in the development of novel therapeutic agents that manipulate protein levels, serving as a critical tool in chemical biology and drug discovery research. -
PROTAC Linker
t-Boc-Aminooxy-PEG7-methane is a PEG-based linker designed for use in PROTAC synthesis, enabling targeted protein degradation. It facilitates the conjugation of various moieties, enhancing the efficiency of PROTAC molecules in cellular contexts. This compound is essential for researchers developing innovative therapeutic strategies leveraging targeted protein degradation. -
PROTAC linker
N-(m-PEG4)-N'-(m-PEG4)-O-(m-PEG4)-O'-(propargyl-PEG4)-Cy5 functions as a PEG-based PROTAC linker, facilitating the development of targeted protein degradation strategies. This compound features an alkyne group that enables copper-catalyzed azide-alkyne cycloaddition (CuAAc), making it a valuable reagent for click chemistry applications. Its utility in synthesizing PROTACs significantly contributes to research in targeted therapeutics and protein interaction studies. -
Crosslinking Reagent
Mal-PEG3-NH2 is a linear heterobifunctional polyethylene glycol (PEG) crosslinking reagent featuring a maleimide group and an amine. This compound effectively facilitates the conjugation of thiol-containing molecules to amines, utilizing its PEG spacer to enhance solubility and biocompatibility. Mal-PEG3-NH2 is ideal for applications in bioconjugation, protein labeling, and the development of targeted therapeutics. -
PROTAC Linkers
DBCO-PEG4-NH-Boc is a PEG-based linker designed for use in the synthesis of PROTACs (proteolysis-targeting chimeras). Featuring a DBCO functional group, this compound facilitates strain-promoted alkyne-azide cycloaddition (SPAAC) with azide-containing molecules, enabling efficient conjugation. Its primary application lies in the development of targeted protein degradation strategies, making it valuable in research focused on cellular regulation and therapeutic development. -
PROTAC Linkers
Azido-PEG35-amine is a PEG-based linker designed for the synthesis of PROTACs (proteolysis-targeting chimeras), facilitating targeted protein degradation. This compound features an azide group that participates in copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) with DBCO or BCN groups, making it a versatile tool for chemical biology applications and the development of novel therapeutics. -
PROTAC Linker
Methylamino-PEG2-acid is a polyethylene glycol (PEG)-based linker specifically designed for the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of target proteins to E3 ligases, enhancing targeted protein degradation pathways. Its applications extend to drug discovery and the development of novel therapeutic strategies in cancer and other diseases through controlled modulation of protein levels. -
PROTAC Linkers
Hydroxy-PEG1-C2-methyl ester is a polyethylene glycol (PEG) based linker specifically designed for the synthesis of protein degradation agents known as PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of various ligands to E3 ligase binding domains, enabling targeted degradation of specific proteins. Its application in research includes the development of innovative therapeutic strategies for cancer and other diseases by harnessing the ubiquitin-proteasome system. -
PROTAC Linker
Tos-PEG9-Boc is a polyethylene glycol (PEG) linker designed for use in the synthesis of proteolysis targeting chimeras (PROTACs). This compound facilitates the conjugation of the E3 ubiquitin ligase to target proteins, enhancing the selective degradation of oncogenic proteins in cellular systems. It serves as a crucial component in the development of PROTACs for targeted protein degradation research applications. -
PROTAC Linker
Fmoc-NH-PEG3-amide-CH2OCH2COOH is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound enhances the solubility and biocompatibility of PROTACs, facilitating efficient target degradation in cellular assays. It is suitable for research applications focusing on protein modulation and the development of novel therapeutic agents.

