Catalog No.
Product Name
Application
Product Information
Citations
-
PROTAC Linker
Bis-methacrylate-PEG5 is a polyethylene glycol (PEG)-based linker designed for PROTAC (PROteolysis TArgeting Chimeras) synthesis. This flexible linker facilitates the effective conjugation of target proteins to E3 ligases, enhancing the targeted degradation of specific proteins within cells. Its unique properties make it suitable for research applications focused on protein degradation and cellular pathways modulation. -
PROTAC Linkers
Pip-alkyne-Ph-COOCH3 is a versatile PROTAC linker designed for the synthesis of PROTAC ARD-266. This compound features an alkyne group, facilitating its use in click chemistry through copper-catalyzed azide-alkyne cycloaddition (CuAAc). It plays a critical role in forming stable linkages between target proteins and E3 ligases, supporting research in targeted protein degradation and related therapeutic applications. -
PROTAC Linkers
Br-PEG6-C2-acid is a PEG-derived linker designed for use in PROTAC (proteolysis-targeting chimera) synthesis. This compound enables the conjugation of target proteins to E3 ligases, facilitating targeted protein degradation. It is valuable for research applications focusing on elucidating protein function and therapeutics development in cancer and other diseases. -
PROTAC Linker
(S,R,S)-AHPC-amide-PEG5-C2-azide is a PROTAC linker designed to facilitate the formation of proteolysis-targeting chimeras (PROTACs). This compound features an azide functional group that allows for bioconjugation and can be utilized in the targeted degradation of specific proteins. Its unique structure enables researchers to explore various biological pathways and therapeutic targets in chemical biology studies and drug development efforts. -
PROTAC Linker
Boc-piperazine-pyridine-COOH is a PROTAC linker that facilitates the synthesis of targeted protein degradation molecules. Its structure includes a piperazine and pyridine moiety, making it valuable for the development of bifunctional compounds aimed at modulating protein levels within cells. This linker is essential in research focused on targeted therapy applications and studies investigating protein homeostasis mechanisms. -
PROTAC Linkers
N-Me-N-bis(PEG4-acid) is a polyethylene glycol (PEG)-based linker specifically designed for use in the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound enhances the solubility and cellular permeability of PROTACs, facilitating the effective degradation of target proteins. Key research applications include targeted protein degradation studies and the development of novel therapeutic agents in cancer and other diseases. -
PROTAC Linker
NH2-Ph-NH-cyclohexane-NH-Boc is a PROTAC linker that facilitates the creation of targeted protein degradation systems. This compound is integral in the synthesis of PROTAC erf3a Degrader-1, enabling the selective degradation of specific proteins within cellular environments. It is especially useful in the study of protein homeostasis and the development of innovative therapeutic strategies. -
PROTAC Linker
Carboxyrhodamine 110-PEG4-alkyne is a PEG (polyethylene glycol)-based linker specifically designed for the synthesis of PROTACs (proteolysis-targeting chimeras). It facilitates the effective conjugation of target proteins to an E3 ligase for selective degradation. This compound is essential for researchers investigating targeted protein degradation mechanisms and developing novel therapeutic strategies. Its properties enable precise modulation of biological activity in various cellular contexts. -
PROTAC Linker
Azido-PEG10-azide is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound features an azide functional group that facilitates copper-catalyzed azide-alkyne cycloaddition (CuAAc) with alkyne-containing molecules. Additionally, it can participate in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN-modified compounds, making it a versatile tool for bioconjugation and targeted protein degradation research. -
PROTAC Linkers
Boc-Aminooxy-PEG4-CH2CO2H is a polyethylene glycol (PEG)-based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the conjugation of ligand components, enabling the selective degradation of target proteins through the ubiquitin-proteasome system. Its chemical structure allows for improved solubility and bioavailability in various biological applications, making it a valuable tool in targeted protein degradation research. -
PROTAC Linker
t-Boc-N-amido-PEG6-Tos is a PEG-based linker designed for the development of PROTACs (Proteolysis Targeting Chimeras). This reagent effectively facilitates the conjugation of protein ligands, enhancing compound solubility and stability. Its primary application lies in the synthesis of PROTACs for targeted protein degradation studies, making it an essential tool in drug discovery and therapeutic research. -
PROTAC Linker
Carboxy-PEG2-sulfonic acid is a polyethylene glycol (PEG) based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the effective conjugation of target proteins to ubiquitin ligases, enhancing the targeted degradation of specific proteins. Biological applications include investigating protein regulation and discovery of therapeutic agents through targeted protein degradation mechanisms. -
PROTAC Linker
Bromoacetamido-PEG8-Boc is a polyethylene glycol (PEG)-based linker designed for use in the development of proteolysis-targeting chimeras (PROTACs). This compound facilitates the conjugation of target proteins to E3 ligase recruiters, promoting targeted protein degradation. It is particularly useful in chemical biology and drug discovery applications, where precise modulation of protein levels is required for studying cellular processes and therapeutic interventions. -
PROTAC Linker
N-(Propargyl-PEG2)-N-Boc-PEG3-t-butyl ester is a PEG-based linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This compound features an alkyne moiety that enables efficient click chemistry through copper-catalyzed azide-alkyne cycloaddition (CuAAc) with azide-containing molecules. Its application in PROTAC development facilitates targeted protein degradation, making it a valuable tool for researchers in drug discovery and chemical biology. -
PROTAC Linker
Active-mono-sulfone-PEG8-acid is a PEG-based linker designed for use in the development of PROTACs (Proteolysis Targeting Chimeras). This compound facilitates the conjugation of target ligands to E3 ligase components, thereby promoting targeted protein degradation. It offers significant potential in various biological research applications, including drug discovery and therapeutic development, by optimizing the spatial arrangement for effective and selective ubiquitination. -
PROTAC Linkers
Boc-Pip-alkyne-Ph-COOH is a PROTAC linker designed for use in the synthesis of targeted protein degraders. It facilitates the development of PROTACs, including ARD-266, which effectively promotes degradation of the androgen receptor in AR-positive prostate cancer cell lines such as LNCaP, VCaP, and 22Rv1, exhibiting DC50 values of 0.2-1 nM. This compound features an alkyne group that enables copper-catalyzed azide-alkyne cycloaddition (CuAAc), making it essential for click chemistry applications in chemical biology research. -
PROTAC Linkers
Azide-PEG6-Tos is a PEG-based linker designed for use in the synthesis of PROTACs, targeting the PROTAC technology. This compound features an azide functional group, enabling its participation in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-containing molecules. Additionally, it can engage in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN-functionalized partners. Its versatility makes it a valuable tool for chemical biology research focused on targeted protein degradation. -
PROTAC Linkers
Bromo-PEG3-THP is a PEG-based linker designed for use in PROTAC (Proteolysis Targeting Chimera) synthesis. This compound facilitates the conjugation of target proteins to E3 ligases, enabling the selective degradation of specific proteins within cellular contexts. It is ideal for research applications focusing on targeted protein degradation and the development of novel therapeutic strategies. -
PROTAC Linkers
Boc-C1-PEG3-C4-OBn is a versatile PROTAC linker that incorporates a polyethylene glycol (PEG) structure. This compound facilitates the synthesis of various PROTACs, including the SGK3 degrader-1. By connecting ligands for E3 ubiquitin ligases and target proteins, Boc-C1-PEG3-C4-OBn is instrumental in harnessing the ubiquitin-proteasome system for the selective degradation of target proteins, providing valuable insights for protein regulation studies and therapeutic applications. -
PROTAC Linker
Fmoc-PEG6-NHS ester is a polyethylene glycol (PEG)-derived linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). It facilitates the conjugation of E3 ligase ligands with target proteins, enabling targeted protein degradation. This compound is essential for research in pharmacology, particularly in the development of innovative therapeutic strategies that leverage the ubiquitin-proteasome system. -
PROTAC Linker
N-(Mal-PEG6)-N-bis(PEG7-TCO) is a PEG-based linker specifically designed for PROTAC synthesis. This compound features a TCO moiety that facilitates the inverse electron demand Diels-Alder reaction (iEDDA) with tetrazine-containing molecules, enabling effective targeting and degradation of proteins. It is widely used in chemical biology to create novel therapeutics and to study protein interactions and degradation pathways. -
PROTAC Linker
2-(1-(Boc)Piperidin-4-yl)-2,2-difluoroacetic acid serves as a versatile PROTAC linker essential for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the recruitment of E3 ubiquitin ligases, enabling targeted degradation of specific proteins within cellular pathways. Its application is crucial in the development of innovative therapeutic strategies for diseases related to protein dysregulation. -
PROTAC Linker
2-(9-Bromononyl)-1,3-dioxolane is a crucial PROTAC linker designed to facilitate the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound provides flexibility and enhances the efficacy of targeted protein degradation applications. Its structural characteristics make it suitable for diverse research endeavors in chemical biology and therapeutic development. -
PROTAC Linker
12-Methoxy-12-oxododecanoic acid functions as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound is instrumental in connecting target ligands with E3 ligase recruiters, enhancing the degradation of specific proteins through the cellular ubiquitin-proteasome system. Its unique structure supports the efficient creation of PROTACs for use in various research applications, including studies on targeted protein degradation and the exploration of therapeutic interventions. -
PROTAC Linker
MeNH-PEG2-NHMe is a polyethylene glycol (PEG) linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This versatile linker facilitates the conjugation of target proteins with E3 ubiquitin ligases, enhancing the specificity and affinity in targeted protein degradation applications. Its structural properties contribute to improved solubility and bioavailability, making it suitable for various biochemical assays and drug discovery research. -
PROTAC Linker
(S,R,S)-AHPC-PEG2-NHS ester is a synthetic linker designed for use in PROTAC (Proteolysis Targeting Chimera) applications. Its structure features an E3 ligase ligand coupled with a polyethylene glycol (PEG) spacer, enhancing solubility in aqueous environments. The reactive NHS ester functional group allows for efficient conjugation with amine-containing compounds, facilitating the development of targeted protein degradation strategies in chemical biology research. -
PROTAC Linker
m-PEG11-Br is a polyethylene glycol (PEG) based linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates efficient protein degradation by linking a ligand to an E3 ubiquitin ligase. m-PEG11-Br is essential for the development of novel PROTACs aimed at targeted protein modulation in various biological research applications. -
PROTAC Linker
tert-Butyl (trans-3-formylcyclobutyl)carbamate is a novel PROTAC linker that facilitates the development of Proteolysis Targeting Chimeras (PROTACs). Its unique structure allows for efficient conjugation to E3 ligase ligands and target proteins, promoting targeted ubiquitination and subsequent degradation. This reagent is valuable for researchers investigating protein degradation pathways and therapeutic interventions in various diseases. -
PROTAC Linker
5-(Methylthio)pentan-1-amine serves as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound enables the selective degradation of target proteins by linking them to E3 ligases, thus enhancing targeted therapeutic strategies in drug discovery. Its application in the synthesis of PROTACs supports research in protein degradation pathways and targeted cancer therapies. -
PROTAC Linker
3-(3-(3-Ethoxy-3-oxopropoxy)propoxy)propanoic acid serves as a PROTAC linker, facilitating the construction of proteolysis-targeting chimeras (PROTACs). This compound plays a critical role in the development of targeted protein degradation strategies by enhancing the specificity and efficacy of the PROTACs synthesized using it. Its utility in chemical biology makes it a valuable tool for researchers investigating protein regulation and therapeutic applications. -
PROTAC Linker
4-Bromo-1,1-dimethoxybutane serves as a versatile PROTAC linker, essential for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the recruitment of E3 ligase and target proteins to promote ubiquitination and subsequent degradation. It is valuable in drug discovery and development for studying protein interactions and modulation of biological pathways. -
PROTAC Linker
Ethyl 6-aminohexanoate is a versatile PROTAC linker designed to facilitate the synthesis of proteolysis-targeting chimeras (PROTACs). This compound enhances the stability and efficacy of PROTACs by providing a suitable chemical environment for target protein degradation. It is applicable in various research areas, including drug discovery and targeted protein degradation studies. -
PROTAC Linker
Ph-Bis(C1-N-(C2-NH-Boc)2) is a PROTAC linker designed for enhanced protein degradation through targeted protein removal. Its alkyl chain structure facilitates efficient conjugation with ligands and E3 ligases, enabling the development of effective PROTACs. This compound is essential for researchers investigating targeted protein degradation and interrogating cellular mechanisms associated with protein homeostasis. -
PROTAC Linker
Methyl (4-cyanophenyl)acetate serves as a valuable PROTAC linker, facilitating the synthesis of proteolysis-targeting chimeras (PROTACs). This compound enhances the ability to recruit E3 ligases to target proteins, leading to their ubiquitination and subsequent degradation. Its role in PROTAC development is crucial for advancing studies in targeted protein modulation and exploring therapeutic applications in various disease models. -
PROTAC Linker
PEG10-Tos is a PROTAC linker designed for use in the synthesis of proteolysis-targeting chimeras (PROTACs). Its unique structure enhances the efficiency of target protein degradation by enabling effective recruitment of E3 ligases. This compound is critical in the development of small molecule-based therapeutics that harness the ubiquitin-proteasome system for targeted protein modulation in research applications. -
PROTAC Linker
2-(4-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethyl)piperazin-1-yl)acetic acid dihydrochloride acts as a PROTAC linker, facilitating the development of proteolysis-targeting chimeras. This compound plays a crucial role in the synthesis of PROTACs, enabling targeted protein degradation for various biological applications. Its unique structure allows for effective conjugation with target proteins, making it a valuable reagent in drug discovery and cellular biology research. -
PROTAC Linker
Pimeloylchloride is a versatile PROTAC linker that facilitates the synthesis of Proteolysis Targeting Chimeras (PROTACs). This compound effectively connects the target protein and an E3 ligase, enabling the selective degradation of specific proteins within cells. Its application is crucial for research in targeted protein degradation and the development of novel therapeutic strategies. -
PROTAC Linker
19-Methoxy-19-oxononadecanoic acid is a versatile PROTAC linker that facilitates the design and synthesis of proteolysis-targeting chimeras (PROTACs). This compound is instrumental in the selective degradation of target proteins through the harnessing of the ubiquitin-proteasome system. Its application in biochemical research enables the study of targeted protein modulation and therapeutic development. -
PROTAC Linker
16-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexadecanoic acid serves as a linker in the development of PROTACs, facilitating targeted protein degradation. Its long aliphatic chain enhances cellular permeability and optimal interaction with protein targets. This compound is essential for constructing bifunctional molecules that engage E3 ligases and specific proteins, making it a valuable tool in chemical biology and therapeutic development. -
PROTAC Linker
Ethyl 2-(4-(((trifluoromethyl)sulfonyl)oxy)cyclohex-3-en-1-yl)acetate serves as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound's unique structural features enhance the stability and efficiency of PROTACs, making it a valuable tool in targeted protein degradation research. Its application supports advancements in studies aimed at modulating specific protein interactions in various biological contexts. -
PROTAC Linker
14-Mercaptotetradecanoic acid acts as a PROTAC linker, facilitating the construction of proteolysis-targeting chimeras (PROTACs). This compound is essential for enabling targeted protein degradation, which holds significant promise in cancer research and drug discovery. Its application in PROTAC development supports studies aimed at elucidating protein function and therapeutic intervention strategies. -
PROTAC Linker
Boc-Piperidine-piperazine-Cbz is a PROTAC linker utilized in the development of proteolysis-targeting chimeras (PROTACs). This compound plays a crucial role in facilitating the selective degradation of target proteins via the ubiquitin-proteasome system. It is integral for research applications aimed at studying protein regulation, cellular signaling, and targeted therapeutics in various disease contexts. -
PROTAC Linker
Methyl 2-(3-(2-hydroxyethyl)bicyclo[1.1.1]pentan-1-yl)acetate functions as a linker in the development of Proteolysis Targeting Chimeras (PROTACs). This compound facilitates the assembly of bifunctional molecules that recruit target proteins for ubiquitin-mediated degradation. It is crucial for applications in targeted protein degradation research, offering potential therapeutic advancements in various diseases through specific modulation of protein levels. -
PROTAC Linker
tert-Butyl 4-(2-(methylamino)ethyl)piperidine-1-carboxylate is a PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates targeted protein degradation by linking a ligand that binds to the target protein with an E3 ligase recruiter. It serves as a crucial component in the development of novel therapeutic agents aimed at selectively degrading specific proteins involved in various diseases. -
PROTAC Linker
tert-Butyl (4-(piperazin-1-yl)butyl)carbamate serves as a versatile PROTAC linker, facilitating the development of proteolysis-targeting chimeras (PROTACs). This compound enables the effective recruitment of E3 ligases to target proteins, enhancing targeted protein degradation. Its application is crucial in chemical biology research for the design and synthesis of novel PROTAC molecules aimed at therapeutic interventions. -
PROTAC Linker
Benzyl (2-(2-bromoethoxy)ethyl)carbamate is a PROTAC linker designed specifically for synthesizing Proteolysis Targeting Chimeras (PROTACs). This compound facilitates the development of novel proteolysis-based therapeutic strategies by promoting targeted degradation of specific proteins within cells. Its application in drug discovery and development enables researchers to explore new avenues for addressing diseases driven by dysregulated proteins. -
PROTAC Linker
Hexane-1,6-diamine dihydrochloride serves as a potent PROTAC linker, facilitating the construction of Proteolysis Targeting Chimeras (PROTACs). This compound enables effective recruitment of E3 ligases to target proteins for ubiquitination and subsequent degradation. Its application in the synthesis of PROTACs makes it a valuable tool for biochemical research, particularly in the study of protein regulation and therapeutic development. -
PROTAC Linker
N-Boc-15-aminopentadecanoic acid is a PROTAC linker characterized by its alkane chain, featuring a terminal carboxylic acid and Boc-protected amino groups. This compound facilitates the synthesis of PROTACs by enabling the formation of stable amide bonds with primary amine groups through reaction with activators like EDC or HATU. The Boc protective group can be deprotected under mild acidic conditions to yield the free amine, thus enhancing the versatility in the development of targeted protein degradation strategies. -
PROTAC Linker
2-(4-Boronophenyl)acetic acid functions as a PROTAC linker, facilitating the design and synthesis of proteolysis-targeting chimeras (PROTACs). This compound is essential for creating bifunctional molecules that induce targeted protein degradation, a key approach in chemical biology and therapeutic development. Its unique boron-containing structure provides specific reactivity, enhancing the efficiency of PROTAC formation. Research applications include cancer therapy, neurodegenerative disease studies, and other areas where precise modulation of protein levels is required. -
PROTAC Linker
tert-Butyl 3-(4-aminophenyl)azetidine-1-carboxylate is a versatile PROTAC linker designed for the synthesis of proteolysis-targeting chimeras (PROTACs). This compound facilitates the formation of bifunctional molecules that induce targeted protein degradation, providing a valuable tool for drug discovery and development. Its structural characteristics enhance the pharmacological properties of the resulting PROTACs, enabling researchers to explore novel therapeutic strategies in various biological contexts.
