Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD2461 is a novel and potent PARP inhibitor with lower affinity to P-glycoprotein. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12393 |
|---|---|
| Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 |
| CAS Number | 1174043-16-3 |
| SMILES | COC1CCN(CC1)C(=O)C2=C(C=CC(=C2)CC3=NNC(=O)C4=CC=CC=C43)F |
| Synonyms | AZD2461, AZD 2461 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 73 mg/mL (184.61 mM) | |
| Water | Insoluble | ||
| Ethanol | 29 mg/mL (73.33 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.29 mL | 126.44 mL | 252.89 mL |
| 0.5 mM | 5.06 mL | 25.29 mL | 50.58 mL |
| 1 mM | 2.53 mL | 12.64 mL | 25.29 mL |
| 5 mM | 0.51 mL | 2.53 mL | 5.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
