Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ME0328 is a potent and selective PARP inhibitor with IC50 of 0.89 μM for PARP3, about 7-fold selectivity over PARP1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14309 |
|---|---|
| Formula | C19H19N3O2 |
| Molecular Weight | 321.37 |
| CAS Number | 1445251-22-8 |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)CCC2=NC(=O)C3=CC=CC=C3N2 |
| Synonyms | ME 0328 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (186.69 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.12 mL | 155.58 mL | 311.17 mL |
| 0.5 mM | 6.22 mL | 31.12 mL | 62.23 mL |
| 1 mM | 3.11 mL | 15.56 mL | 31.12 mL |
| 5 mM | 0.62 mL | 3.11 mL | 6.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
