Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lanifibranor, also known as IVA-337, is a peroxisome proliferator-activated receptors (PPAR) agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17041 |
|---|---|
| Formula | C19H15ClN2O4S2 |
| Molecular Weight | 434.91 |
| CAS Number | 927961-18-0 |
| SMILES | O=C(O)CCCC(N1S(=O)(C2=CC=C3N=CSC3=C2)=O)=CC4=C1C=CC(Cl)=C4 |
| Synonyms | IVA-337, IVA 337, IVA337 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (170.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.99 mL | 114.97 mL | 229.93 mL |
| 0.5 mM | 4.6 mL | 22.99 mL | 45.99 mL |
| 1 mM | 2.3 mL | 11.5 mL | 22.99 mL |
| 5 mM | 0.46 mL | 2.3 mL | 4.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
