Loading distributor info...
| Description | BGP-15 is a PARP inhibitor, that can protect against heart failure and atrial fibrillation in mice. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16344 |
|---|---|
| Formula | C14H24Cl2N4O2 |
| Molecular Weight | 351.27 |
| CAS Number | 66611-37-8 |
| SMILES | N=C(NOCC(O)CN1CCCCC1)C2=CN=CC=C2.Cl.Cl |
| Synonyms | BGP 15, BGP15 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (190.73 mM) | |
| Water | 67 mg/mL (190.73 mM) | ||
| Ethanol | 67 mg/mL (190.73 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.47 mL | 142.34 mL | 284.68 mL |
| 0.5 mM | 5.69 mL | 28.47 mL | 56.94 mL |
| 1 mM | 2.85 mL | 14.23 mL | 28.47 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.69 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
