Loading distributor info...
| Description | UPF 1069 is a selective poly(ADP-ribose) polymerase (PARP) 2 inhibitor (IC50 values are 0.3 and 8.0 μM for PARP-2 and PARP-1 respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12750 |
|---|---|
| Formula | C17H13NO3 |
| Molecular Weight | 279.29 |
| CAS Number | 1048371-03-4 |
| SMILES | C1=CC=C(C=C1)C(=O)COC2=CC=CC3=C2C=CNC3=O |
| Synonyms | UPF1069, UPF-1069 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 54 mg/mL (193.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.81 mL | 179.03 mL | 358.05 mL |
| 0.5 mM | 7.16 mL | 35.81 mL | 71.61 mL |
| 1 mM | 3.58 mL | 17.9 mL | 35.81 mL |
| 5 mM | 0.72 mL | 3.58 mL | 7.16 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
