Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMN-673 is an orally bioavailable inhibitor of the nuclear enzyme poly(ADP-ribose) polymerase (PARP) with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11243 |
|---|---|
| Formula | C19H14F2N6O |
| Molecular Weight | 380.35 |
| CAS Number | 1207456-01-6 |
| SMILES | CN1C(=NC=N1)[C@@H]2[C@H](N=C3C=C(C=C4C3=C2NNC4=O)F)C5=CC=C(C=C5)F |
| Synonyms | BMN-673, BMN 673 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 38 mg/mL (99.9 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.29 mL | 131.46 mL | 262.92 mL |
| 0.5 mM | 5.26 mL | 26.29 mL | 52.58 mL |
| 1 mM | 2.63 mL | 13.15 mL | 26.29 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
