Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NU 1025 is a potent poly(ADP-ribose) polymerase (PARP) inhibitor, which potentiates the cytotoxicity of a panel of mechanistically diverse anti-cancer agents in L1210 cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15375 |
|---|---|
| Formula | C9H8N2O2 |
| Molecular Weight | 176.2 |
| CAS Number | 90417-38-2 |
| SMILES | CC1=NC(=O)C2=C(N1)C(=CC=C2)O |
| Synonyms | NU1025, NU-1025 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 34 mg/mL (192.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 6 mg/mL | ||
| In vivo | 40% PEG 400+saline | 17 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 56.75 mL | 283.77 mL | 567.54 mL |
| 0.5 mM | 11.35 mL | 56.75 mL | 113.51 mL |
| 1 mM | 5.68 mL | 28.38 mL | 56.75 mL |
| 5 mM | 1.14 mL | 5.68 mL | 11.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
