Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pamiparib, also known as BGB-290, is a highly potent and selective PARP inhibitor with favorable drug metabolism and pharmacokinetic properties. CAS: 1446261-44-1 (free base) 2086689-94-1 (maleate) 2086689-93-0 (hydrate) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17073 |
|---|---|
| Formula | C16H15FN4O |
| Molecular Weight | 298.32 |
| CAS Number | 1446261-44-4 |
| SMILES | O=C1NN=C2CN(CCC3)[C@@]3(C)C(N4)=C2C5=C4C=C(F)C=C51 |
| Synonyms | BGB-290, BGB 290, BGB290 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (167.61 mM) | |
| Water | Insoluble | ||
| Ethanol | 38 mg/mL (127.38 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.52 mL | 167.61 mL | 335.21 mL |
| 0.5 mM | 6.7 mL | 33.52 mL | 67.04 mL |
| 1 mM | 3.35 mL | 16.76 mL | 33.52 mL |
| 5 mM | 0.67 mL | 3.35 mL | 6.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
