MK-4827 (Niraparib)
MK-4827 is a novel potent, orally bioavailable PARP-1 and PARP-2 inhibitor.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Other Forms of MK-4827 (Niraparib)
Loading distributor info...
Loading distributor info...
| Description | MK-4827 is a novel potent, orally bioavailable PARP-1 and PARP-2 inhibitor. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11026 |
|---|---|
| Formula | C19H20N4O |
| Molecular Weight | 320.4 |
| CAS Number | 1038915-60-4 |
| SMILES | C1C[C@H](CNC1)C2=CC=C(C=C2)N3C=C4C=CC=C(C4=N3)C(=O)N |
| Synonyms | MK4827 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 60 mg/mL (187.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 60 mg/mL (187.27 mM) | ||
| In vivo | 10% DMSO+40% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.21 mL | 156.05 mL | 312.11 mL |
| 0.5 mM | 6.24 mL | 31.21 mL | 62.42 mL |
| 1 mM | 3.12 mL | 15.61 mL | 31.21 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.24 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2