Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GeA-69 is a selective, highly cell permeable allosteric inhibitor of poly-adenosine-diphosphate-ribose polymerase 14 (PARP14) targeting macrodomain 2, with a Kd of 2.1 ?M. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19705 |
|---|---|
| Formula | C20H16N2O |
| Molecular Weight | 300.35 |
| CAS Number | 2143475-98-1 |
| SMILES | CC(NC1=CC=CC=C1C2=CC=CC3=C2NC4=C3C=CC=C4)=O |
| Synonyms | GeA69; GeA 69 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (173.13 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (29.96 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.29 mL | 166.47 mL | 332.94 mL |
| 0.5 mM | 6.66 mL | 33.29 mL | 66.59 mL |
| 1 mM | 3.33 mL | 16.65 mL | 33.29 mL |
| 5 mM | 0.67 mL | 3.33 mL | 6.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
