Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 7ACC1 selectively interfere with lactate fluxes in the lactate-rich tumor microenvironment; inhibits lactate influx but not efflux in tumor cells expressing MCT1 and MCT4 transporters. |
|---|
| Catalog Num | A15810 |
|---|---|
| Formula | C14H15NO4 |
| Molecular Weight | 261.27 |
| CAS Number | 50995-74-9 |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O |
| Synonyms | DEAC, Coumarin D 1421, D 1421 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (172.23 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.27 mL | 191.37 mL | 382.75 mL |
| 0.5 mM | 7.65 mL | 38.27 mL | 76.55 mL |
| 1 mM | 3.83 mL | 19.14 mL | 38.27 mL |
| 5 mM | 0.77 mL | 3.83 mL | 7.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
