Loading distributor info...
| Description | Allopurinol is a structural isomer of hypoxanthine (a naturally occurring purine in the body) and is an inhibitor of the enzyme xanthine oxidase. |
|---|
| Catalog Num | A10056 |
|---|---|
| Formula | C5H3N4NaO |
| Molecular Weight | 158.09 |
| CAS Number | 17795-21-0 |
| SMILES | C1=NNC2=C1C(=NC=N2)[O-].[Na+] |
| Synonyms | Lopurin, Zyloprim, Aloprim |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (188.56 mM) | |
| Water | 30 mg/mL (188.56 mM) | ||
| Ethanol | 2 mg/mL (12.57 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 63.26 mL | 316.28 mL | 632.55 mL |
| 0.5 mM | 12.65 mL | 63.26 mL | 126.51 mL |
| 1 mM | 6.33 mL | 31.63 mL | 63.26 mL |
| 5 mM | 1.27 mL | 6.33 mL | 12.65 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
