Amonafide is a DNA intercalator and topoisomerase II inhibitor for the treatment of neoplastic diseases, one of Antitumor agent.
Loading distributor info...
| Description | Amonafide is a DNA intercalator and topoisomerase II inhibitor for the treatment of neoplastic diseases, one of Antitumor agent. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10071 |
|---|---|
| Formula | C16H17N3O2 |
| Molecular Weight | 283.3 |
| CAS Number | 69408-81-7 |
| SMILES | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)N |
| Synonyms | Xanafide, Quinamed |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (179.99 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (14.11 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.3 mL | 176.49 mL | 352.98 mL |
| 0.5 mM | 7.06 mL | 35.3 mL | 70.6 mL |
| 1 mM | 3.53 mL | 17.65 mL | 35.3 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.06 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
