Loading distributor info...
| Description | AZD2932 is a potent and mutil-targeted protein tyrosine kinase inhibitor with IC50 of 8 nM, 4 nM, 7 nM, and 9 nM for VEGFR-2, PDGFRβ, Flt-3, and c-Kit, respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A14156 |
|---|---|
| Formula | C24H25N5O4 |
| Molecular Weight | 447.49 |
| CAS Number | 883986-34-3 |
| SMILES | CC(C)N1C=C(C=N1)NC(=O)CC2=CC=C(C=C2)OC3=NC=NC4=CC(=C(C=C43)OC)OC |
| Synonyms | AZD-2932,AZD2932 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 78 mg/mL (174.3 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 4 mg/mL (8.94 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.35 mL | 111.73 mL | 223.47 mL |
| 0.5 mM | 4.47 mL | 22.35 mL | 44.69 mL |
| 1 mM | 2.23 mL | 11.17 mL | 22.35 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.47 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
