Loading distributor info...
| Description | AZD3759 is an orally available inhibitor of the epidermal growth factor receptor (EGFR). It binds to and inhibits the activity of EGFR as well as certain mutant forms of EGFR. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15551 |
|---|---|
| Formula | C22H23ClFN5O3 |
| Molecular Weight | 459.9 |
| CAS Number | 1626387-80-1 |
| SMILES | CC1CN(CCN1C(=O)OC2=C(C=C3C(=C2)C(=NC=N3)NC4=C(C(=CC=C4)Cl)F)OC)C |
| Synonyms | AZD 3759 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (173.94 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 18 mg/mL (39.13 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.74 mL | 108.72 mL | 217.44 mL |
| 0.5 mM | 4.35 mL | 21.74 mL | 43.49 mL |
| 1 mM | 2.17 mL | 10.87 mL | 21.74 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.35 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
