Loading distributor info...
| Description | BLZ945 is a potent and selective CSF-1R kinase inhibitor. It attenuates the turnover rate of TAMs while increasing the number of CD8+ T cells that infiltrate cervical and breast carcinomas. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15540 |
|---|---|
| Formula | C20H22N4O3S |
| Molecular Weight | 398.4 |
| CAS Number | 953769-46-5 |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC3=C(C=C2)N=C(S3)NC4CCCCC4O |
| Synonyms | BLZ 945, BLZ-945 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 77 mg/mL (193.23 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 3 mg/mL | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 2.3 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.1 mL | 125.5 mL | 251 mL |
| 0.5 mM | 5.02 mL | 25.1 mL | 50.2 mL |
| 1 mM | 2.51 mL | 12.55 mL | 25.1 mL |
| 5 mM | 0.5 mL | 2.51 mL | 5.02 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
