Loading distributor info...
| Description | C7280948 is an inhibitor of histone arginine methyltransferase PRMT1 with IC50 values of 12.75 uM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13876 |
|---|---|
| Formula | C14H16N2O2S |
| Molecular Weight | 276.35 |
| CAS Number | 587850-67-7 |
| SMILES | C1=CC=C(C=C1)CCNS(=O)(=O)C2=CC=C(C=C2)N |
| Synonyms | C 7280948 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (191.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (18.09 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.19 mL | 180.93 mL | 361.86 mL |
| 0.5 mM | 7.24 mL | 36.19 mL | 72.37 mL |
| 1 mM | 3.62 mL | 18.09 mL | 36.19 mL |
| 5 mM | 0.72 mL | 3.62 mL | 7.24 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
