Loading distributor info...
| Description | EBE-A22 is a derivative of PD 153035 which can inhibit ErbB-1-phosphorylation, whereas EBE-A22 is inactive. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15074 |
|---|---|
| Formula | C17H16BrN3O2 |
| Molecular Weight | 374.23 |
| CAS Number | 229476-53-3 |
| SMILES | CN(C1=CC(=CC=C1)Br)C2=NC=NC3=CC(=C(C=C32)OC)OC |
| Synonyms | EBE-A 22 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (21.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.72 mL | 133.61 mL | 267.22 mL |
| 0.5 mM | 5.34 mL | 26.72 mL | 53.44 mL |
| 1 mM | 2.67 mL | 13.36 mL | 26.72 mL |
| 5 mM | 0.53 mL | 2.67 mL | 5.34 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
