Loading distributor info...
| Description | Fadrozole is a nonsteroidal aromatase inhibitor exhibiting a very potent and selective inhibitory effect of the aromatase enzyme system in vivo and estrogen biosynthesis in vivo. |
|---|
| Catalog Num | A11088 |
|---|---|
| Formula | C14H13N3 |
| Molecular Weight | 223.27 |
| CAS Number | 102676-47-1 |
| SMILES | C1CC(N2C=NC=C2C1)C3=CC=C(C=C3)C#N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (188.1 mM) | |
| Water | Insoluble | ||
| Ethanol | 42 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.79 mL | 223.94 mL | 447.89 mL |
| 0.5 mM | 8.96 mL | 44.79 mL | 89.58 mL |
| 1 mM | 4.48 mL | 22.39 mL | 44.79 mL |
| 5 mM | 0.9 mL | 4.48 mL | 8.96 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
