Loading distributor info...
| Description | FG-2216 is a potent HIF-prolyl hydroxylase inhibitor with IC50 of 3.9 uM for PDH2 enzyme; orally bioavailable and induced significant and reversible Epo induction in vivo, | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15530 |
|---|---|
| Formula | C12H9ClN2O4 |
| Molecular Weight | 280.66 |
| CAS Number | 223387-75-5 |
| SMILES | C1=CC=C2C(=C1)C(=C(N=C2Cl)C(=O)NCC(=O)O)O |
| Synonyms | YM-311 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 48 mg/mL (171.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+40% PEG 300+2% Twenn 80+ddH2O | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.63 mL | 178.15 mL | 356.3 mL |
| 0.5 mM | 7.13 mL | 35.63 mL | 71.26 mL |
| 1 mM | 3.56 mL | 17.82 mL | 35.63 mL |
| 5 mM | 0.71 mL | 3.56 mL | 7.13 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
