Loading distributor info...
| Description | Hydroxyfasudil hydrochloride, metabolite of Fasudil, is a potent Rho-kinase inhibitor and vasodilator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15119 |
|---|---|
| Formula | C14H18ClN3O3S |
| Molecular Weight | 343.83 |
| CAS Number | 155558-32-0 |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CNC3=O.Cl |
| Synonyms | HA-1100 hydrochloride, HA 1100 hydrochloride, HA1100 hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 67 mg/mL (194.86 mM) | |
| Water | Warmed: 59 mg/mL (171.59 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.08 mL | 145.42 mL | 290.84 mL |
| 0.5 mM | 5.82 mL | 29.08 mL | 58.17 mL |
| 1 mM | 2.91 mL | 14.54 mL | 29.08 mL |
| 5 mM | 0.58 mL | 2.91 mL | 5.82 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
