Loading distributor info...
| Description | IM-12 is a cell-permeable indolylmaleimide that acts as a Glycogen synthase kinase 3β (GSK-3β) inhibitor, activating downstream components of canonical Wnt signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14196 |
|---|---|
| Formula | C22H20FN3O2 |
| Molecular Weight | 377.41 |
| CAS Number | 1129669-05-1 |
| SMILES | CC1=C(C2=CC=CC=C2N1)C3=C(C(=O)N(C3=O)C)NCCC4=CC=C(C=C4)F |
| Synonyms | IM12, IM 12 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (190.77 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 10 mg/mL (26.49 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.5 mL | 132.48 mL | 264.96 mL |
| 0.5 mM | 5.3 mL | 26.5 mL | 52.99 mL |
| 1 mM | 2.65 mL | 13.25 mL | 26.5 mL |
| 5 mM | 0.53 mL | 2.65 mL | 5.3 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
