Loading distributor info...
| Description | Ipragliflozin is a highly potent and selective SGLT2 inhibitor with IC50 of 2.8 nM; little and NO potency for SGLT1/3/4/5/6. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13556 |
|---|---|
| Formula | C21H21FO5S |
| Molecular Weight | 404.4559 |
| CAS Number | 761423-87-4 |
| SMILES | C1=CC=C2C(=C1)C=C(S2)CC3=C(C=CC(=C3)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)F |
| Synonyms | ASP 1941, ASP1941 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (192.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 78 mg/mL (192.85 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.72 mL | 123.62 mL | 247.25 mL |
| 0.5 mM | 4.94 mL | 24.72 mL | 49.45 mL |
| 1 mM | 2.47 mL | 12.36 mL | 24.72 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.94 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
